/** * data-structure-typed * * @author Pablo Zeng * @copyright Copyright (c) 2022 Pablo Zeng * @license MIT License */ import type { BSTNOptKeyOrNode, BSTOptions, BTNRep, Comparator, CP, DFSOrderPattern, EntryCallback, FamilyPosition, IterationType, NodeCallback, NodePredicate, OptNode, RBTNColor } from '../../types'; import { BinaryTree } from './binary-tree'; import { IBinaryTree } from '../../interfaces'; import { Queue } from '../queue'; import { isComparable } from '../../utils'; import { ERR, Range, raise } from '../../common'; /** * Represents a Node in a Binary Search Tree. * * @template K - The type of the key. * @template V - The type of the value. */ export class BSTNode { key: K; value?: V; parent?: BSTNode = undefined; /** * Creates an instance of BSTNode. * @remarks Time O(1), Space O(1) * * @param key - The key of the node. * @param [value] - The value associated with the key. */ constructor(key: K, value?: V) { this.key = key; this.value = value; } _left?: BSTNode | null | undefined = undefined; /** * Gets the left child of the node. * @remarks Time O(1), Space O(1) * * @returns The left child. */ get left(): BSTNode | null | undefined { return this._left; } /** * Sets the left child of the node and updates its parent reference. * @remarks Time O(1), Space O(1) * * @param v - The node to set as the left child. */ set left(v: BSTNode | null | undefined) { if (v) v.parent = this; this._left = v; } _right?: BSTNode | null | undefined = undefined; /** * Gets the right child of the node. * @remarks Time O(1), Space O(1) * * @returns The right child. */ get right(): BSTNode | null | undefined { return this._right; } /** * Sets the right child of the node and updates its parent reference. * @remarks Time O(1), Space O(1) * * @param v - The node to set as the right child. */ set right(v: BSTNode | null | undefined) { if (v) v.parent = this; this._right = v; } _height: number = 0; /** * Gets the height of the node (used in self-balancing trees). * @remarks Time O(1), Space O(1) * * @returns The height. */ /* istanbul ignore next -- covered by AVLTree/RedBlackTree tests (subclass uses height) */ get height(): number { return this._height; } /** * Sets the height of the node. * @remarks Time O(1), Space O(1) * * @param value - The new height. */ /* istanbul ignore next -- covered by AVLTree/RedBlackTree tests (subclass uses height) */ set height(value: number) { this._height = value; } _color: RBTNColor = 'BLACK'; /** * Gets the color of the node (used in Red-Black trees). * @remarks Time O(1), Space O(1) * * @returns The node's color. */ /* istanbul ignore next -- covered by RedBlackTree tests (subclass uses color) */ get color(): RBTNColor { return this._color; } /** * Sets the color of the node. * @remarks Time O(1), Space O(1) * * @param value - The new color. */ /* istanbul ignore next -- covered by RedBlackTree tests (subclass uses color) */ set color(value: RBTNColor) { this._color = value; } _count: number = 1; /** * Gets the count of nodes in the subtree rooted at this node (used in order-statistic trees). * @remarks Time O(1), Space O(1) * * @returns The subtree node count. */ /* istanbul ignore next -- internal field used by subclasses */ get count(): number { return this._count; } /** * Sets the count of nodes in the subtree. * @remarks Time O(1), Space O(1) * * @param value - The new count. */ /* istanbul ignore next -- internal field used by subclasses */ set count(value: number) { this._count = value; } /** * Gets the position of the node relative to its parent. * @remarks Time O(1), Space O(1) * * @returns The family position (e.g., 'ROOT', 'LEFT', 'RIGHT'). */ get familyPosition(): FamilyPosition { if (!this.parent) { return this.left || this.right ? 'ROOT' : 'ISOLATED'; } if (this.parent.left === this) { return this.left || this.right ? 'ROOT_LEFT' : 'LEFT'; } else if (this.parent.right === this) { return this.left || this.right ? 'ROOT_RIGHT' : 'RIGHT'; } return 'MAL_NODE'; } } /** * Represents a Binary Search Tree (BST). * Keys are ordered, allowing for faster search operations compared to a standard Binary Tree. * @template K - The type of the key. * @template V - The type of the value. * @template R - The type of the raw data object (if using `toEntryFn`). * * 1. Node Order: Each node's left child has a lesser value, and the right child has a greater value. * 2. Unique Keys: No duplicate keys in a standard BST. * 3. Efficient Search: Enables quick search, minimum, and maximum operations. * 4. Inorder Traversal: Yields nodes in ascending order. * 5. Logarithmic Operations: Ideal operations like insertion, deletion, and searching are O(log n) time-efficient. * 6. Balance Variability: Can become unbalanced; special types maintain balance. * 7. No Auto-Balancing: Standard BSTs don't automatically balance themselves. * * @example * // BST delete and search after deletion * const bst = new BST([11, 3, 15, 1, 8, 13, 16, 2, 6, 9, 12, 14, 4, 7, 10, 5]); * * // Delete a leaf node * bst.delete(1); * console.log(bst.has(1)); // false; * * // Delete a node with one child * bst.delete(2); * console.log(bst.has(2)); // false; * * // Delete a node with two children * bst.delete(3); * console.log(bst.has(3)); // false; * * // Size decreases with each deletion * console.log(bst.size); // 13; * * // Other nodes remain searchable * console.log(bst.has(11)); // true; * console.log(bst.has(15)); // true; * @example * // Merge 3 sorted datasets * const dataset1 = new BST([ * [1, 'A'], * [7, 'G'] * ]); * const dataset2 = [ * [2, 'B'], * [6, 'F'] * ]; * const dataset3 = new BST([ * [3, 'C'], * [5, 'E'], * [4, 'D'] * ]); * * // Merge datasets into a single BinarySearchTree * const merged = new BST(dataset1); * merged.setMany(dataset2); * merged.merge(dataset3); * * // Verify merged dataset is in sorted order * console.log([...merged.values()]); // ['A', 'B', 'C', 'D', 'E', 'F', 'G']; * @example * // BST with custom objects for expression evaluation * interface Expression { * id: number; * operator: string; * precedence: number; * } * * // BST efficiently stores and retrieves operators by precedence * const operatorTree = new BST( * [ * [1, { id: 1, operator: '+', precedence: 1 }], * [2, { id: 2, operator: '*', precedence: 2 }], * [3, { id: 3, operator: '/', precedence: 2 }], * [4, { id: 4, operator: '-', precedence: 1 }], * [5, { id: 5, operator: '^', precedence: 3 }] * ], * { isMapMode: false } * ); * * console.log(operatorTree.size); // 5; * * // Quick lookup of operators * const mult = operatorTree.get(2); * console.log(mult?.operator); // '*'; * console.log(mult?.precedence); // 2; * * // Check if operator exists * console.log(operatorTree.has(5)); // true; * console.log(operatorTree.has(99)); // false; * * // Retrieve operator by precedence level * const expNode = operatorTree.getNode(3); * console.log(expNode?.key); // 3; * console.log(expNode?.value?.precedence); // 2; * * // Delete operator and verify * operatorTree.delete(1); * console.log(operatorTree.has(1)); // false; * console.log(operatorTree.size); // 4; * * // Get tree height for optimization analysis * const treeHeight = operatorTree.getHeight(); * console.log(treeHeight); // > 0; * * // Remaining operators are still accessible * const remaining = operatorTree.get(2); * console.log(remaining); // defined; * @example * // Find lowest common ancestor * const bst = new BST([20, 10, 30, 5, 15, 25, 35, 3, 7, 12, 18]); * * // LCA helper function * const findLCA = (num1: number, num2: number): number | undefined => { * const path1 = bst.getPathToRoot(num1); * const path2 = bst.getPathToRoot(num2); * // Find the first common ancestor * return findFirstCommon(path1, path2); * }; * * function findFirstCommon(arr1: (number | undefined)[], arr2: (number | undefined)[]): number | undefined { * for (const num of arr1) { * if (arr2.indexOf(num) !== -1) { * return num; * } * } * return undefined; * } * * // Assertions * console.log(findLCA(3, 10)); // 7; * console.log(findLCA(5, 35)); // 15; * console.log(findLCA(20, 30)); // 25; */ export class BST extends BinaryTree implements IBinaryTree { /** * Creates an instance of BST. * @remarks Time O(N log N) or O(N^2) depending on `isBalanceAdd` in `addMany` and input order. Space O(N). * * @param [keysNodesEntriesOrRaws=[]] - An iterable of items to set. * @param [options] - Configuration options for the BST, including comparator. */ constructor( keysNodesEntriesOrRaws: Iterable = [], options?: BSTOptions ) { super([], options); if (options) { // Use the 'in' operator to check if the field is present if ('comparator' in options && options.comparator !== undefined) { this._comparator = options.comparator; } else { this._comparator = this._createDefaultComparator(); } if (options.enableOrderStatistic) { this._enableOrderStatistic = true; } } else { this._comparator = this._createDefaultComparator(); } if (keysNodesEntriesOrRaws) this.setMany(keysNodesEntriesOrRaws); } protected override _root?: BSTNode = undefined; protected _enableOrderStatistic: boolean = false; /** * Gets the root node of the tree. * @remarks Time O(1) * * @returns The root node. */ override get root(): OptNode> { return this._root; } /** * The comparator function used to determine the order of keys in the tree. * @remarks Time O(1) Space O(1) */ protected readonly _comparator: Comparator; /** * Gets the comparator function used by the tree. * @remarks Time O(1) * * @returns The comparator function. */ get comparator(): Comparator { return this._comparator; } /** * (Protected) Creates a new BST node. * @remarks Time O(1), Space O(1) * * @param key - The key for the new node. * @param [value] - The value for the new node (used if not in Map mode). * @returns The newly created BSTNode. */ override createNode(key: K, value?: V): BSTNode { return new BSTNode(key, value); } /** * Ensures the input is a node. If it's a key or entry, it searches for the node. * @remarks Time O(log N) (height of the tree), O(N) worst-case. * * @param keyNodeOrEntry - The item to resolve to a node. * @param [iterationType=this.iterationType] - The traversal method to use if searching. * @returns The resolved node, or undefined if not found. */ override ensureNode( keyNodeOrEntry: K | BSTNode | [K | null | undefined, V | undefined] | null | undefined, iterationType: IterationType = this.iterationType ): OptNode> { return super.ensureNode(keyNodeOrEntry, iterationType) ?? undefined; } /** * Checks if the given item is a `BSTNode` instance. * @remarks Time O(1), Space O(1) * * @param keyNodeOrEntry - The item to check. * @returns True if it's a BSTNode, false otherwise. */ override isNode( keyNodeOrEntry: K | BSTNode | [K | null | undefined, V | undefined] | null | undefined ): keyNodeOrEntry is BSTNode { return keyNodeOrEntry instanceof BSTNode; } /** * Checks if the given key is valid (comparable). * @remarks Time O(1) * * @param key - The key to validate. * @returns True if the key is valid, false otherwise. */ override isValidKey(key: unknown): key is K { return isComparable(key); } /** * Depth-first search traversal * @example * // Depth-first traversal * const bst = new BST([5, 3, 7, 1, 4]); * const inOrder = bst.dfs(node => node.key, 'IN'); * console.log(inOrder); // [1, 3, 4, 5, 7]; */ override dfs(): (K | undefined)[]; override dfs>>( callback: C, pattern?: DFSOrderPattern, onlyOne?: boolean, startNode?: K | BSTNode | [K | null | undefined, V | undefined] | null | undefined, iterationType?: IterationType ): ReturnType[]; /** * Performs a Depth-First Search (DFS) traversal. * @remarks Time O(N), visits every node. Space O(log N) for the call/explicit stack. O(N) worst-case. * * @template C - The type of the callback function. * @param [callback=this._DEFAULT_NODE_CALLBACK] - Function to call on each node. * @param [pattern='IN'] - The traversal order ('IN', 'PRE', 'POST'). * @param [onlyOne=false] - If true, stops after the first callback. * @param [startNode=this._root] - The node to start from. * @param [iterationType=this.iterationType] - The traversal method. * @returns An array of callback results. */ override dfs>>( callback: C = this._DEFAULT_NODE_CALLBACK as C, pattern: DFSOrderPattern = 'IN', onlyOne: boolean = false, startNode: K | BSTNode | [K | null | undefined, V | undefined] | null | undefined = this._root, iterationType: IterationType = this.iterationType ): ReturnType[] { return super.dfs(callback, pattern, onlyOne, startNode, iterationType); } /** * BinaryTree level-order traversal * @example * // Breadth-first traversal * const bst = new BST([5, 3, 7]); * const result = bst.bfs(node => node.key); * console.log(result.length); // 3; */ override bfs(): (K | undefined)[]; override bfs>>( callback: C, startNode?: K | BSTNode | [K | null | undefined, V | undefined] | null | undefined, iterationType?: IterationType ): ReturnType[]; /** * Performs a Breadth-First Search (BFS) or Level-Order traversal. * @remarks Time O(N), visits every node. Space O(N) in the worst case for the queue. * * @template C - The type of the callback function. * @param [callback=this._DEFAULT_NODE_CALLBACK] - Function to call on each node. * @param [startNode=this._root] - The node to start from. * @param [iterationType=this.iterationType] - The traversal method. * @returns An array of callback results. */ override bfs>>( callback: C = this._DEFAULT_NODE_CALLBACK as C, startNode: K | BSTNode | [K | null | undefined, V | undefined] | null | undefined = this._root, iterationType: IterationType = this.iterationType ): ReturnType[] { return super.bfs(callback, startNode, iterationType, false); } /** * Level-order grouping * @example * // Level-order grouping * const bst = new BST([5, 3, 7, 1, 4]); * const levels = bst.listLevels(node => node.key); * console.log(levels); // toBeInstanceOf; * console.log(levels[0].length); // 1; // root level has 1 node * const allKeys = levels.flat().sort((a, b) => a - b); * console.log(allKeys); // [1, 3, 4, 5, 7]; */ override listLevels(): (K | undefined)[][]; override listLevels>>( callback: C, startNode?: K | BSTNode | [K | null | undefined, V | undefined] | null | undefined, iterationType?: IterationType ): ReturnType[][]; /** * Returns a 2D array of nodes, grouped by level. * @remarks Time O(N), visits every node. Space O(N) for the result array and the queue/stack. * * @template C - The type of the callback function. * @param [callback=this._DEFAULT_NODE_CALLBACK] - Function to call on each node. * @param [startNode=this._root] - The node to start from. * @param [iterationType=this.iterationType] - The traversal method. * @returns A 2D array of callback results. */ override listLevels>>( callback: C = this._DEFAULT_NODE_CALLBACK as C, startNode: K | BSTNode | [K | null | undefined, V | undefined] | null | undefined = this._root, iterationType: IterationType = this.iterationType ): ReturnType[][] { return super.listLevels(callback, startNode, iterationType, false); } /** * Gets the first node matching a predicate. * @remarks Time O(log N) if searching by key, O(N) if searching by predicate. Space O(log N) or O(N). * * @param keyNodeEntryOrPredicate - The key, node, entry, or predicate function to search for. * @param [startNode=this._root] - The node to start the search from. * @param [iterationType=this.iterationType] - The traversal method. * @returns The first matching node, or undefined if not found. * @example * // Get node object by key * const bst = new BST([[5, 'root'], [3, 'left'], [7, 'right']]); * const node = bst.getNode(3); * console.log(node?.key); // 3; * console.log(node?.value); // 'left'; */ override getNode( keyNodeEntryOrPredicate: | K | BSTNode | [K | null | undefined, V | undefined] | null | undefined | NodePredicate>, startNode: BSTNOptKeyOrNode> = this._root, iterationType: IterationType = this.iterationType ): OptNode> { // Fast-path: key lookup should not allocate arrays or build predicate closures. // (This is a hot path for get/has in Node Mode.) if (keyNodeEntryOrPredicate === null || keyNodeEntryOrPredicate === undefined) return undefined; // If a predicate is provided, defer to the full search logic. if (this._isPredicate(keyNodeEntryOrPredicate)) { return this.getNodes(keyNodeEntryOrPredicate, true, startNode, iterationType)[0] ?? undefined; } // NOTE: Range is not part of this overload, but callers may still pass it at runtime. // Let search handle it. if (keyNodeEntryOrPredicate instanceof Range) { return ( this.getNodes( keyNodeEntryOrPredicate, true, startNode as K | BSTNode | [K | null | undefined, V | undefined] | null | undefined, iterationType )[0] ?? undefined ); } let targetKey: K | undefined; if (this.isNode(keyNodeEntryOrPredicate)) { targetKey = keyNodeEntryOrPredicate.key; } else if (this.isEntry(keyNodeEntryOrPredicate)) { const k = keyNodeEntryOrPredicate[0]; if (k === null || k === undefined) return undefined; targetKey = k; } else { targetKey = keyNodeEntryOrPredicate; } const start = this.ensureNode(startNode); if (!start) return undefined; const NIL = this._NIL as unknown as BSTNode | null | undefined; let cur: BSTNode | null | undefined = start; const cmpFn = this._comparator; while (cur && cur !== NIL) { const c = cmpFn(targetKey, cur.key); if (c === 0) return cur; cur = c < 0 ? cur._left : cur._right; } return undefined; } /** * Search nodes by predicate * @example * // Search nodes by predicate * const bst = new BST([[1, 'a'], [2, 'b'], [3, 'c'], [4, 'd']]); * const found = bst.search(node => node.key > 2, true); * console.log(found.length); // >= 1; */ override search( keyNodeEntryOrPredicate: | K | BSTNode | [K | null | undefined, V | undefined] | null | undefined | NodePredicate> | Range, onlyOne?: boolean ): (K | undefined)[]; override search>>( keyNodeEntryOrPredicate: | K | BSTNode | [K | null | undefined, V | undefined] | null | undefined | NodePredicate> | Range, onlyOne: boolean, callback: C, startNode?: K | BSTNode | [K | null | undefined, V | undefined] | null | undefined, iterationType?: IterationType ): ReturnType[]; /** * Searches the tree for nodes matching a predicate, key, or range. * @remarks This is an optimized search for a BST. If searching by key or range, it prunes branches. * Time O(H + M) for key/range search (H=height, M=matches). O(N) for predicate search. * Space O(log N) for the stack. * * @template C - The type of the callback function. * @param keyNodeEntryOrPredicate - The key, node, entry, predicate, or range to search for. * @param [onlyOne=false] - If true, stops after finding the first match. * @param [callback=this._DEFAULT_NODE_CALLBACK] - A function to call on matching nodes. * @param [startNode=this._root] - The node to start the search from. * @param [iterationType=this.iterationType] - Whether to use 'RECURSIVE' or 'ITERATIVE' search. * @returns An array of results from the callback function for each matching node. */ override search>>( keyNodeEntryOrPredicate: | K | BSTNode | [K | null | undefined, V | undefined] | null | undefined | NodePredicate> | Range, onlyOne = false, callback: C = this._DEFAULT_NODE_CALLBACK as C, startNode: K | BSTNode | [K | null | undefined, V | undefined] | null | undefined = this._root, iterationType: IterationType = this.iterationType ): ReturnType[] { if (keyNodeEntryOrPredicate === undefined) return []; if (keyNodeEntryOrPredicate === null) return []; startNode = this.ensureNode(startNode); if (!startNode) return []; // Fast-path: key lookup (unique keys) using a tight BST walk (no allocations). // This is the hot path for get/has/search by key. const isRange = this.isRange(keyNodeEntryOrPredicate); const isPred = !isRange && this._isPredicate(keyNodeEntryOrPredicate); if (!isRange && !isPred) { let targetKey: K | undefined; if (this.isNode(keyNodeEntryOrPredicate)) { targetKey = keyNodeEntryOrPredicate.key; } else if (this.isEntry(keyNodeEntryOrPredicate)) { const k = keyNodeEntryOrPredicate[0]; if (k !== null && k !== undefined) targetKey = k; } else { targetKey = keyNodeEntryOrPredicate; } if (targetKey === undefined) return []; const NIL = this._NIL as unknown as BSTNode | null | undefined; const cmpFn = this._comparator; let cur: BSTNode | null | undefined = startNode; // Loop intentionally avoids getters and extra type checks. while (cur && cur !== NIL) { const c = cmpFn(targetKey, cur.key); if (c === 0) return [callback(cur)]; cur = c < 0 ? cur._left : cur._right; } return []; } let predicate: NodePredicate>; if (isRange) { predicate = node => { /* istanbul ignore next -- node is always defined in iteration callbacks */ if (!node) return false; return (keyNodeEntryOrPredicate).isInRange(node.key, this._comparator); }; } else { predicate = this._ensurePredicate(keyNodeEntryOrPredicate); } // Optimization: Pruning logic const shouldVisitLeft = (cur: BSTNode | null | undefined) => { /* istanbul ignore next -- defensive: cur is always defined when called from iteration */ if (!cur) return false; if (!this.isRealNode(cur.left)) return false; if (isRange) { // Range search: Only go left if the current key is >= the lower bound const range = keyNodeEntryOrPredicate; const leftS = range.low; const leftI = range.includeLow; return (leftI && this._compare(cur.key, leftS) >= 0) || (!leftI && this._compare(cur.key, leftS) > 0); } if (!isRange && !this._isPredicate(keyNodeEntryOrPredicate)) { // Key search: Only go left if current key > target key const benchmarkKey = this._extractKey(keyNodeEntryOrPredicate); return benchmarkKey !== null && benchmarkKey !== undefined && this._compare(cur.key, benchmarkKey) > 0; } return true; // Predicate search: must visit all }; const shouldVisitRight = (cur: BSTNode | null | undefined) => { /* istanbul ignore next -- defensive */ if (!cur) return false; if (!this.isRealNode(cur.right)) return false; if (isRange) { // Range search: Only go right if current key <= upper bound const range = keyNodeEntryOrPredicate; const rightS = range.high; const rightI = range.includeHigh; return (rightI && this._compare(cur.key, rightS) <= 0) || (!rightI && this._compare(cur.key, rightS) < 0); } if (!isRange && !this._isPredicate(keyNodeEntryOrPredicate)) { // Key search: Only go right if current key < target key const benchmarkKey = this._extractKey(keyNodeEntryOrPredicate); return benchmarkKey !== null && benchmarkKey !== undefined && this._compare(cur.key, benchmarkKey) < 0; } return true; // Predicate search: must visit all }; return super._dfs( callback, 'IN', // In-order is efficient for range/key search onlyOne, startNode, iterationType, false, shouldVisitLeft, shouldVisitRight, () => true, // shouldVisitRoot (always visit) cur => !!cur && predicate(cur) // shouldProcessRoot (only process if predicate matches) ); } /** * Find all keys in a range * @example * // Find all keys in a range * const bst = new BST([10, 20, 30, 40, 50]); * console.log(bst.rangeSearch([15, 35])); // [20, 30]; */ rangeSearch(range: Range | [K, K]): (K | undefined)[]; rangeSearch>>( range: Range | [K, K], callback: C, startNode?: K | BSTNode | [K | null | undefined, V | undefined] | null | undefined, iterationType?: IterationType ): ReturnType[]; /** * Performs an optimized search for nodes within a given key range. * @remarks Time O(H + M), where H is tree height and M is the number of matches. * * @template C - The type of the callback function. * @param range - A `Range` object or a `[low, high]` tuple. * @param [callback=this._DEFAULT_NODE_CALLBACK] - A function to call on matching nodes. * @param [startNode=this._root] - The node to start the search from. * @param [iterationType=this.iterationType] - The traversal method. * @returns An array of callback results. */ rangeSearch>>( range: Range | [K, K], callback: C = this._DEFAULT_NODE_CALLBACK as C, startNode: K | BSTNode | [K | null | undefined, V | undefined] | null | undefined = this._root, iterationType: IterationType = this.iterationType ) { const searchRange: Range = range instanceof Range ? range : new Range(range[0], range[1]); return this.search(searchRange, false, callback, startNode, iterationType); } // ─── Order-Statistic Methods ─────────────────────────── /** * Returns the element at the k-th position in tree order (0-indexed). * @remarks Time O(log n), Space O(1) iterative / O(log n) recursive. Requires `enableOrderStatistic: true`. * Tree order is defined by the comparator — ascending by default, but respects custom comparators (e.g. descending). * * @param k - The 0-based position in tree order (0 = first element). * @returns The key at position k, or `undefined` if out of bounds. * @example * // Order-statistic on BST * const tree = new BST([30, 10, 50, 20, 40], { enableOrderStatistic: true }); * console.log(tree.getByRank(0)); // 10; * console.log(tree.getByRank(4)); // 50; * console.log(tree.getRank(30)); // 2; */ getByRank(k: number): K | undefined; /** * Returns the element at the k-th position in tree order and applies a callback. * @remarks Time O(log n), Space O(1) iterative / O(log n) recursive. Requires `enableOrderStatistic: true`. * * @param k - The 0-based position in tree order (0 = first element). * @param callback - Callback to apply to the found node. * @param iterationType - Iteration strategy ('ITERATIVE' or 'RECURSIVE'). * @returns The callback result, or `undefined` if out of bounds. */ getByRank>>( k: number, callback: C, iterationType?: IterationType ): ReturnType | undefined; getByRank>>( k: number, callback: C = this._DEFAULT_NODE_CALLBACK as C, iterationType: IterationType = this.iterationType ): K | undefined | ReturnType | undefined { if (!this._enableOrderStatistic) { raise(Error, ERR.orderStatisticNotEnabled('getByRank')); } if (k < 0 || k >= this._size) return undefined; let actualCallback: C | undefined = undefined; let actualIterationType: IterationType = this.iterationType; if (typeof callback === 'string') { actualIterationType = callback; } else if (callback) { actualCallback = callback; if (iterationType) { actualIterationType = iterationType; } } const node = actualIterationType === 'RECURSIVE' ? this._getByRankRecursive(this._root, k) : this._getByRankIterative(this._root, k); if (!node) return undefined; return actualCallback ? actualCallback(node) : node.key; } /** * Returns the 0-based rank of a key (number of elements that precede it in tree order). * @remarks Time O(log n), Space O(1) iterative / O(log n) recursive. Requires `enableOrderStatistic: true`. * Tree order is defined by the comparator. When the key is not found, returns the insertion position. * * @param keyNodeEntryOrPredicate - The key, node, entry `[K, V]`, or predicate to find. * @returns The rank (0-indexed), or -1 if the tree is empty or input is invalid. */ getRank( keyNodeEntryOrPredicate: | K | BSTNode | [K | null | undefined, V | undefined] | null | undefined | NodePredicate> ): number; /** * Returns the 0-based rank (number of preceding elements in tree order) with explicit iteration type. * @remarks Time O(log n), Space O(1) iterative / O(log n) recursive. Requires `enableOrderStatistic: true`. * * @param keyNodeEntryOrPredicate - The key, node, entry, or predicate to find. * @param iterationType - Iteration strategy ('ITERATIVE' or 'RECURSIVE'). * @returns The rank (0-indexed), or -1 if the tree is empty or input is invalid. */ getRank( keyNodeEntryOrPredicate: | K | BSTNode | [K | null | undefined, V | undefined] | null | undefined | NodePredicate>, iterationType: IterationType ): number; getRank( keyNodeEntryOrPredicate: | K | BSTNode | [K | null | undefined, V | undefined] | null | undefined | NodePredicate>, iterationType: IterationType = this.iterationType ): number { if (!this._enableOrderStatistic) { raise(Error, ERR.orderStatisticNotEnabled('getRank')); } if (!this._root || this._size === 0) return -1; let actualIterationType: IterationType = this.iterationType; if (iterationType) actualIterationType = iterationType; // Resolve key from input let key: K | undefined; if (typeof keyNodeEntryOrPredicate === 'function') { // Predicate: find first matching node const results = this.search(keyNodeEntryOrPredicate as NodePredicate>, true); if (results.length === 0 || results[0] === undefined) return -1; key = results[0]; } else if (keyNodeEntryOrPredicate === null || keyNodeEntryOrPredicate === undefined) { return -1; } else if (this.isNode(keyNodeEntryOrPredicate)) { key = keyNodeEntryOrPredicate.key; } else if (Array.isArray(keyNodeEntryOrPredicate)) { key = keyNodeEntryOrPredicate[0] ?? undefined; if (key === undefined || key === null) return -1; } else { key = keyNodeEntryOrPredicate as K; } if (key === undefined) return -1; return actualIterationType === 'RECURSIVE' ? this._getRankRecursive(this._root, key) : this._getRankIterative(this._root, key); } /** * Returns elements by position range in tree order (0-indexed, inclusive on both ends). * @remarks Time O(log n + k), Space O(k), where k = end - start + 1. Requires `enableOrderStatistic: true`. * * @param start - Start position (inclusive, 0-indexed). Clamped to 0 if negative. * @param end - End position (inclusive, 0-indexed). Clamped to size-1 if too large. * @returns Array of keys in tree order within the specified range. */ rangeByRank(start: number, end: number): (K | undefined)[]; /** * Returns elements by position range in tree order with callback and optional iteration type. * @remarks Time O(log n + k), Space O(k), where k = end - start + 1. Requires `enableOrderStatistic: true`. * * @param start - Start rank (inclusive, 0-indexed). * @param end - End rank (inclusive, 0-indexed). * @param callback - Callback to apply to each node in the range. * @param iterationType - Iteration strategy ('ITERATIVE' or 'RECURSIVE'). * @returns Array of callback results for nodes in the rank range. */ rangeByRank>>( start: number, end: number, callback: C, iterationType?: IterationType ): ReturnType[]; rangeByRank>>( start: number, end: number, callback: C = this._DEFAULT_NODE_CALLBACK as C, iterationType: IterationType = this.iterationType ): (K | undefined)[] | ReturnType[] { if (!this._enableOrderStatistic) { raise(Error, ERR.orderStatisticNotEnabled('rangeByRank')); } if (this._size === 0) return []; // Clamp const lo = Math.max(0, start); const hi = Math.min(this._size - 1, end); if (lo > hi) return []; let actualCallback: C | undefined = undefined; let actualIterationType: IterationType = this.iterationType; if (typeof callback === 'string') { actualIterationType = callback; } else if (callback) { actualCallback = callback; if (iterationType) { actualIterationType = iterationType; } } const results: (K | undefined | ReturnType)[] = []; const count = hi - lo + 1; // Find the lo-th node, then in-order traverse count nodes const startNode = actualIterationType === 'RECURSIVE' ? this._getByRankRecursive(this._root, lo) : this._getByRankIterative(this._root, lo); if (!startNode) return []; // In-order traversal from startNode collecting count elements let collected = 0; const cb = actualCallback ?? this._DEFAULT_NODE_CALLBACK as C; // Use higher() to iterate — it's already O(log n) amortized per step let current: BSTNode | undefined = startNode; while (current && collected < count) { results.push(cb(current)); collected++; if (collected < count) { // Find next in-order node current = this._next(current); } } return results as (K | undefined)[] | ReturnType[]; } /** * Adds a new node to the BST based on key comparison. * @remarks Time O(log N), where H is tree height. O(N) worst-case (unbalanced tree), O(log N) average. Space O(1). * * @param keyNodeOrEntry - The key, node, or entry to set. * @param [value] - The value, if providing just a key. * @returns True if the addition was successful, false otherwise. * @example * // Set a key-value pair * const bst = new BST(); * bst.set(1, 'one'); * bst.set(2, 'two'); * console.log(bst.get(1)); // 'one'; */ override set( keyNodeOrEntry: K | BSTNode | [K | null | undefined, V | undefined] | null | undefined, value?: V ): boolean { const [newNode] = this._keyValueNodeOrEntryToNodeAndValue(keyNodeOrEntry, value); if (newNode === undefined) return false; if (this._root === undefined) { this._setRoot(newNode); if (this._isMapMode && this.isRealNode(newNode)) this._store.set(newNode.key, newNode); this._size++; this._updateCount(newNode); return true; } let current = this._root; while (current !== undefined) { if (this._compare(current.key, newNode.key) === 0) { // Key exists, replace node this._replaceNode(current, newNode); if (this._isMapMode && this.isRealNode(newNode)) this._store.set(current.key, newNode); return true; } else if (this._compare(current.key, newNode.key) > 0) { // Go left if (current.left === undefined) { current.left = newNode; if (this._isMapMode && this.isRealNode(newNode)) this._store.set(newNode.key, newNode); this._size++; this._updateCountAlongPath(newNode); return true; } if (current.left !== null) current = current.left; } else { // Go right if (current.right === undefined) { current.right = newNode; if (this._isMapMode && this.isRealNode(newNode)) this._store.set(newNode.key, newNode); this._size++; this._updateCountAlongPath(newNode); return true; } if (current.right !== null) current = current.right; } } /* istanbul ignore next -- defensive: traversal always finds undefined slot before exhausting tree */ return false; } /** * Adds multiple items to the tree. * @remarks If `isBalanceAdd` is true, sorts the input and builds a balanced tree. Time O(N log N) (due to sort and balanced set). * If false, adds items one by one. Time O(N * H), which is O(N^2) worst-case. * Space O(N) for sorting and recursion/iteration stack. * * @param keysNodesEntriesOrRaws - An iterable of items to set. * @param [values] - An optional parallel iterable of values. * @param [isBalanceAdd=true] - If true, builds a balanced tree from the items. * @param [iterationType=this.iterationType] - The traversal method for balanced set (recursive or iterative). * @returns An array of booleans indicating the success of each individual `set` operation. * @example * // Set multiple key-value pairs * const bst = new BST(); * bst.setMany([[1, 'a'], [2, 'b'], [3, 'c']]); * console.log(bst.size); // 3; * console.log(bst.get(2)); // 'b'; */ override setMany( keysNodesEntriesOrRaws: Iterable>>, values?: Iterable, isBalanceAdd = true, iterationType: IterationType = this.iterationType ): boolean[] { const inserted: boolean[] = []; const valuesIterator: Iterator | undefined = values?.[Symbol.iterator](); if (!isBalanceAdd) { // Standard O(N*H) insertion for (let kve of keysNodesEntriesOrRaws) { const val = valuesIterator?.next().value; if (this.isRaw(kve)) kve = this._toEntryFn!(kve); inserted.push(this.set(kve, val)); } return inserted; } // Balanced O(N log N) insertion const realBTNExemplars: { key: R | K | BSTNode | [K | null | undefined, V | undefined] | null | undefined; value: V | undefined; orgIndex: number; }[] = []; let i = 0; for (const kve of keysNodesEntriesOrRaws) { realBTNExemplars.push({ key: kve, value: valuesIterator?.next().value, orgIndex: i++ }); } // Sort items by key const sorted = realBTNExemplars.sort(({ key: a }, { key: b }) => { let keyA: K | undefined | null, keyB: K | undefined | null; if (this.isRaw(a)) keyA = this._toEntryFn!(a)[0]; else if (this.isEntry(a)) keyA = a[0]; else if (this.isRealNode(a)) keyA = a.key; else keyA = a as K; if (this.isRaw(b)) keyB = this._toEntryFn!(b)[0]; else if (this.isEntry(b)) keyB = b[0]; else if (this.isRealNode(b)) keyB = b.key; else keyB = b as K; if (keyA != null && keyB != null) return this._compare(keyA, keyB); return 0; }); // Recursive balanced build const _dfs = (arr: typeof realBTNExemplars) => { if (arr.length === 0) return; const mid = Math.floor((arr.length - 1) / 2); const { key, value, orgIndex } = arr[mid]; if (this.isRaw(key)) { const entry = this._toEntryFn!(key); inserted[orgIndex] = this.set(entry); } else { inserted[orgIndex] = this.set(key, value); } _dfs(arr.slice(0, mid)); _dfs(arr.slice(mid + 1)); }; // Iterative balanced build const _iterate = () => { const n = sorted.length; const stack: Array<[number, number]> = [[0, n - 1]]; while (stack.length > 0) { const popped = stack.pop(); /* istanbul ignore next -- stack.pop() on non-empty stack always returns a value */ if (!popped) continue; const [l, r] = popped; if (l > r) continue; const m = l + Math.floor((r - l) / 2); const { key, value, orgIndex } = sorted[m]; if (this.isRaw(key)) { const entry = this._toEntryFn!(key); inserted[orgIndex] = this.set(entry); } else { inserted[orgIndex] = this.set(key, value); } stack.push([m + 1, r]); stack.push([l, m - 1]); } }; if (iterationType === 'RECURSIVE') _dfs(sorted); else _iterate(); return inserted; } /** * Returns the first key with a value >= target. * Equivalent to Java TreeMap.ceiling. * Time Complexity: O(log n) average, O(h) worst case. * Space Complexity: O(h) for recursion, O(1) for iteration. * @example * // Find the least key ≥ target * const bst = new BST([10, 20, 30, 40, 50]); * console.log(bst.ceiling(25)); // 30; * console.log(bst.ceiling(30)); // 30; * console.log(bst.ceiling(55)); // undefined; */ ceiling( keyNodeEntryOrPredicate: | K | BSTNode | [K | null | undefined, V | undefined] | null | undefined | NodePredicate> ): K | undefined; /** * Returns the first node with a key >= target and applies callback. * Time Complexity: O(log n) average, O(h) worst case. * Space Complexity: O(h) for recursion, O(1) for iteration. */ ceiling>>( keyNodeEntryOrPredicate: | K | BSTNode | [K | null | undefined, V | undefined] | null | undefined | NodePredicate>, callback: C, iterationType?: IterationType ): ReturnType; ceiling>>( keyNodeEntryOrPredicate: | K | BSTNode | [K | null | undefined, V | undefined] | null | undefined | NodePredicate>, callback: C = this._DEFAULT_NODE_CALLBACK as C, iterationType?: IterationType ): K | undefined | ReturnType { let actualCallback: C | undefined = undefined; let actualIterationType: IterationType = this.iterationType; if (typeof callback === 'string') { actualIterationType = callback; } else if (callback) { actualCallback = callback; if (iterationType) { actualIterationType = iterationType; } } const node = this._bound(keyNodeEntryOrPredicate, true, actualIterationType); if (!actualCallback) { return node?.key; } return node ? actualCallback(node) : undefined; } /** * Returns the first key with a value > target. * Equivalent to Java TreeMap.higher. * Time Complexity: O(log n) average, O(h) worst case. * Space Complexity: O(h) for recursion, O(1) for iteration. * @example * // Find the least key strictly > target * const bst = new BST([10, 20, 30, 40]); * console.log(bst.higher(20)); // 30; * console.log(bst.higher(40)); // undefined; */ higher( keyNodeEntryOrPredicate: | K | BSTNode | [K | null | undefined, V | undefined] | null | undefined | NodePredicate> ): K | undefined; /** * Returns the first node with a key > target and applies callback. * Time Complexity: O(log n) average, O(h) worst case. * Space Complexity: O(h) for recursion, O(1) for iteration. */ higher>>( keyNodeEntryOrPredicate: | K | BSTNode | [K | null | undefined, V | undefined] | null | undefined | NodePredicate>, callback: C, iterationType?: IterationType ): ReturnType; higher>>( keyNodeEntryOrPredicate: | K | BSTNode | [K | null | undefined, V | undefined] | null | undefined | NodePredicate>, callback: C = this._DEFAULT_NODE_CALLBACK as C, iterationType?: IterationType ): K | undefined | ReturnType { let actualCallback: C | undefined = undefined; let actualIterationType: IterationType = this.iterationType; if (typeof callback === 'string') { actualIterationType = callback; } else if (callback) { actualCallback = callback; if (iterationType) { actualIterationType = iterationType; } } const node = this._bound(keyNodeEntryOrPredicate, false, actualIterationType); if (!actualCallback) { return node?.key; } return node ? actualCallback(node) : undefined; } /** * Returns the first key with a value <= target. * Equivalent to Java TreeMap.floor. * Time Complexity: O(log n) average, O(h) worst case. * Space Complexity: O(h) for recursion, O(1) for iteration. * @example * // Find the greatest key ≤ target * const bst = new BST([10, 20, 30, 40, 50]); * console.log(bst.floor(25)); // 20; * console.log(bst.floor(10)); // 10; * console.log(bst.floor(5)); // undefined; */ floor( keyNodeEntryOrPredicate: | K | BSTNode | [K | null | undefined, V | undefined] | null | undefined | NodePredicate> ): K | undefined; /** * Returns the first node with a key <= target and applies callback. * Time Complexity: O(log n) average, O(h) worst case. * Space Complexity: O(h) for recursion, O(1) for iteration. */ floor>>( keyNodeEntryOrPredicate: | K | BSTNode | [K | null | undefined, V | undefined] | null | undefined | NodePredicate>, callback: C, iterationType?: IterationType ): ReturnType; floor>>( keyNodeEntryOrPredicate: | K | BSTNode | [K | null | undefined, V | undefined] | null | undefined | NodePredicate>, callback: C = this._DEFAULT_NODE_CALLBACK as C, iterationType?: IterationType ): K | undefined | ReturnType { if (keyNodeEntryOrPredicate === null || keyNodeEntryOrPredicate === undefined) { /* istanbul ignore next */ if (typeof callback === 'string' || !callback) { return undefined; } return undefined; } let actualCallback: C | undefined = undefined; let actualIterationType: IterationType = this.iterationType; if (typeof callback === 'string') { actualIterationType = callback; } else if (callback) { actualCallback = callback; if (iterationType) { actualIterationType = iterationType; } } if (this._isPredicate(keyNodeEntryOrPredicate)) { const node = this._floorByPredicate(keyNodeEntryOrPredicate, actualIterationType); if (!actualCallback) { return node?.key; } return node ? actualCallback(node) : undefined; } let targetKey: K | undefined; if (this.isNode(keyNodeEntryOrPredicate)) { targetKey = keyNodeEntryOrPredicate.key; } else if (this.isEntry(keyNodeEntryOrPredicate)) { const key = keyNodeEntryOrPredicate[0]; if (key === null || key === undefined) { /* istanbul ignore next */ if (typeof callback === 'string' || !callback) { return undefined; } return undefined; } targetKey = key; } else { targetKey = keyNodeEntryOrPredicate; } if (targetKey !== undefined) { const node = this._floorByKey(targetKey, actualIterationType); /* istanbul ignore next */ if (!actualCallback) { return node?.key; } return node ? actualCallback(node) : undefined; } /* istanbul ignore next -- targetKey is always defined if we reach here (null/undefined caught above) */ if (typeof callback === 'string' || !callback) { return undefined; } /* istanbul ignore next */ return undefined; } /** * Returns the first key with a value < target. * Equivalent to Java TreeMap.lower. * Time Complexity: O(log n) average, O(h) worst case. * Space Complexity: O(h) for recursion, O(1) for iteration. * @example * // Find the greatest key strictly < target * const bst = new BST([10, 20, 30, 40]); * console.log(bst.lower(30)); // 20; * console.log(bst.lower(10)); // undefined; */ lower( keyNodeEntryOrPredicate: | K | BSTNode | [K | null | undefined, V | undefined] | null | undefined | NodePredicate> ): K | undefined; /** * Returns the first node with a key < target and applies callback. * Time Complexity: O(log n) average, O(h) worst case. * Space Complexity: O(h) for recursion, O(1) for iteration. */ lower>>( keyNodeEntryOrPredicate: | K | BSTNode | [K | null | undefined, V | undefined] | null | undefined | NodePredicate>, callback: C, iterationType?: IterationType ): ReturnType; lower>>( keyNodeEntryOrPredicate: | K | BSTNode | [K | null | undefined, V | undefined] | null | undefined | NodePredicate>, callback?: C | IterationType, iterationType?: IterationType ): K | undefined | ReturnType { if (keyNodeEntryOrPredicate === null || keyNodeEntryOrPredicate === undefined) { /* istanbul ignore next */ if (typeof callback === 'string' || !callback) { return undefined; } /* istanbul ignore next */ return undefined; } let actualCallback: C | undefined = undefined; let actualIterationType: IterationType = this.iterationType; if (typeof callback === 'string') { actualIterationType = callback; } else if (callback) { actualCallback = callback; if (iterationType) { actualIterationType = iterationType; } } if (this._isPredicate(keyNodeEntryOrPredicate)) { const node = this._lowerByPredicate(keyNodeEntryOrPredicate, actualIterationType); if (!actualCallback) { return node?.key; } return node ? actualCallback(node) : undefined; } let targetKey: K | undefined; if (this.isNode(keyNodeEntryOrPredicate)) { targetKey = keyNodeEntryOrPredicate.key; } else if (this.isEntry(keyNodeEntryOrPredicate)) { const key = keyNodeEntryOrPredicate[0]; if (key === null || key === undefined) { /* istanbul ignore next */ if (typeof callback === 'string' || !callback) { return undefined; } /* istanbul ignore next */ return undefined; } targetKey = key; } else { targetKey = keyNodeEntryOrPredicate; } if (targetKey !== undefined) { const node = this._lowerByKey(targetKey, actualIterationType); if (!actualCallback) { return node?.key; } return node ? actualCallback(node) : undefined; } /* istanbul ignore next -- targetKey is always defined if we reach here (null/undefined caught above) */ if (typeof callback === 'string' || !callback) { return undefined; } /* istanbul ignore next */ return undefined; } lesserOrGreaterTraverse(): (K | undefined)[]; lesserOrGreaterTraverse>>( callback: C, lesserOrGreater?: number, targetNode?: K | BSTNode | [K | null | undefined, V | undefined] | null | undefined, iterationType?: IterationType ): ReturnType[]; /** * Traverses the tree and returns nodes that are lesser or greater than a target node. * @remarks Time O(N), as it performs a full traversal. Space O(log N) or O(N). * * @template C - The type of the callback function. * @param [callback=this._DEFAULT_NODE_CALLBACK] - Function to call on matching nodes. * @param [lesserOrGreater=-1] - -1 for lesser, 1 for greater, 0 for equal. * @param [targetNode=this._root] - The node to compare against. * @param [iterationType=this.iterationType] - The traversal method. * @returns An array of callback results. */ lesserOrGreaterTraverse>>( callback: C = this._DEFAULT_NODE_CALLBACK as C, lesserOrGreater: CP = -1, targetNode: K | BSTNode | [K | null | undefined, V | undefined] | null | undefined = this._root, iterationType: IterationType = this.iterationType ): ReturnType[] { const targetNodeEnsured = this.ensureNode(targetNode); const ans: ReturnType>>[] = []; if (!this._root || !targetNodeEnsured) return ans; const targetKey = targetNodeEnsured.key; if (iterationType === 'RECURSIVE') { const dfs = (cur: BSTNode) => { const compared = this._compare(cur.key, targetKey); if (Math.sign(compared) == lesserOrGreater) ans.push(callback(cur)); if (this.isRealNode(cur.left)) dfs(cur.left); if (this.isRealNode(cur.right)) dfs(cur.right); }; dfs(this._root); return ans; } else { const queue = new Queue>([this._root]); while (queue.length > 0) { const cur = queue.shift(); if (this.isRealNode(cur)) { const compared = this._compare(cur.key, targetKey); if (Math.sign(compared) == lesserOrGreater) ans.push(callback(cur)); if (this.isRealNode(cur.left)) queue.push(cur.left); if (this.isRealNode(cur.right)) queue.push(cur.right); } } return ans; } } /** * Rebuilds the tree to be perfectly balanced. * @remarks Time O(N) (O(N) for DFS, O(N) for sorted build). Space O(N) for node array and recursion stack. * * @param [iterationType=this.iterationType] - The traversal method for the initial node export. * @returns True if successful, false if the tree was empty. * @example * // Rebalance the tree * const bst = new BST(); * // Insert in sorted order (worst case for BST) * for (let i = 1; i <= 7; i++) bst.add(i); * console.log(bst.isAVLBalanced()); // false; * bst.perfectlyBalance(); * console.log(bst.isAVLBalanced()); // true; */ perfectlyBalance(iterationType: IterationType = this.iterationType): boolean { const nodes = this.dfs(node => node, 'IN', false, this._root, iterationType); const n = nodes.length; this._clearNodes(); if (n === 0) return false; // Build balanced tree from sorted array const build = (l: number, r: number, parent?: BSTNode): BSTNode | undefined => { if (l > r) return undefined; const m = l + ((r - l) >> 1); const root = nodes[m]! as BSTNode; const leftChild = build(l, m - 1, root); const rightChild = build(m + 1, r, root); root.left = leftChild; root.right = rightChild; root.parent = parent; return root; }; const newRoot = build(0, n - 1, undefined); this._setRoot(newRoot); this._size = n; return true; } /** * Checks if the tree meets the AVL balance condition (height difference <= 1). * @remarks Time O(N), as it must visit every node to compute height. Space O(log N) for recursion or O(N) for iterative map. * * @param [iterationType=this.iterationType] - The traversal method. * @returns True if the tree is AVL balanced, false otherwise. * @example * // Check if tree is height-balanced * const bst = new BST([3, 1, 5, 2, 4]); * console.log(bst.isAVLBalanced()); // true; */ isAVLBalanced(iterationType: IterationType = this.iterationType): boolean { if (!this._root) return true; let balanced = true; if (iterationType === 'RECURSIVE') { // Recursive height check const _height = (cur: BSTNode | null | undefined): number => { if (!cur) return 0; const leftHeight = _height(cur.left); const rightHeight = _height(cur.right); if (Math.abs(leftHeight - rightHeight) > 1) balanced = false; return Math.max(leftHeight, rightHeight) + 1; }; _height(this._root); } else { // Iterative post-order height check const stack: BSTNode[] = []; let node: OptNode> = this._root, last: OptNode> = undefined; const depths: Map, number> = new Map(); while (stack.length > 0 || node) { if (node) { stack.push(node); if (node.left !== null) node = node.left; } else { node = stack[stack.length - 1]; if (!node.right || last === node.right) { node = stack.pop(); if (node) { const left = node.left ? depths.get(node.left)! : -1; const right = node.right ? depths.get(node.right)! : -1; if (Math.abs(left - right) > 1) return false; depths.set(node, 1 + Math.max(left, right)); last = node; node = undefined; } } else node = node.right; } } } return balanced; } /** * Creates a new BST by mapping each [key, value] pair to a new entry. * @remarks Time O(N * H), where N is nodes in this tree, and H is height of the new tree during insertion. * Space O(N) for the new tree. * * @template MK - New key type. * @template MV - New value type. * @template MR - New raw type. * @param callback - A function to map each [key, value] pair. * @param [options] - Options for the new BST. * @param [thisArg] - `this` context for the callback. * @returns A new, mapped BST. * @example * // Transform to new tree * const bst = new BST([[1, 10], [2, 20], [3, 30]]); * const doubled = bst.map((value, key) => [key, (value ?? 0) * 2] as [number, number]); * console.log([...doubled.values()]); // [20, 40, 60]; */ override map( callback: EntryCallback, options?: Partial>, thisArg?: unknown ): BST { const out = this._createLike([], options); let index = 0; // Iterates in-order for (const [key, value] of this) { out.set(callback.call(thisArg, value, key, index++, this)); } return out; } /** * Deletes nodes that match a key, node, entry, predicate, or range. * * @remarks * Time Complexity: O(N) for search + O(M log N) for M deletions, where N is tree size. * Space Complexity: O(M) for storing matched nodes and result map. * * @template K - The key type. * @template V - The value type. * * @param keyNodeEntryOrPredicate - The search criteria. Can be one of: * - A key (type K): searches for exact key match using the comparator. * - A BSTNode: searches for the matching node in the tree. * - An entry tuple: searches for the key-value pair. * - A NodePredicate function: tests each node and returns true for matches. * - A Range object: searches for nodes whose keys fall within the specified range (inclusive/exclusive based on range settings). * - null or undefined: treated as no match, returns empty results. * * @param onlyOne - If true, stops the search after finding the first match and only deletes that one node. * If false (default), searches for and deletes all matching nodes. * * @param startNode - The node to start the search from. Can be: * - A key, node, or entry: the method resolves it to a node and searches from that subtree. * - null or undefined: defaults to the root, searching the entire tree. * - Default value: this._root (the tree's root). * * @param iterationType - Controls the internal traversal implementation: * - 'RECURSIVE': uses recursive function calls for traversal. * - 'ITERATIVE': uses explicit stack-based iteration. * - Default: this.iterationType (the tree's default iteration mode). * * @returns A Map containing the deletion results: * - Key: the matched node's key. * - Value: true if the deletion succeeded, false if it failed (e.g., key not found during deletion phase). * - If no nodes match the search criteria, the returned map is empty. */ deleteWhere( keyNodeEntryOrPredicate: | K | BSTNode | [K | null | undefined, V | undefined] | null | undefined | NodePredicate> | Range, onlyOne = false, startNode: K | BSTNode | [K | null | undefined, V | undefined] | null | undefined = this._root, iterationType: IterationType = this.iterationType ): boolean { const toDelete = this.search(keyNodeEntryOrPredicate, onlyOne, node => node, startNode, iterationType); let deleted = false; for (const node of toDelete) { if (this.delete(node)) deleted = true; } return deleted; } /** * (Protected) Creates the default comparator function for keys that don't have a custom comparator. * @remarks Time O(1) Space O(1) * @returns The default comparator function. */ protected _createDefaultComparator(): Comparator { return (a: K, b: K): number => { // If both keys are comparable (primitive types), use direct comparison if (isComparable(a) && isComparable(b)) { if (a > b) return 1; if (a < b) return -1; return 0; } /* istanbul ignore next -- Date objects satisfy isComparable(), so this branch is unreachable via default comparator */ // Date keys: compare by getTime() if (a instanceof Date && b instanceof Date) { const ta = a.getTime(); const tb = b.getTime(); if (Number.isNaN(ta) || Number.isNaN(tb)) raise(TypeError, ERR.invalidDate('BST')); return ta > tb ? 1 : ta < tb ? -1 : 0; } // If keys are objects and no comparator is provided, throw an error if (typeof a === 'object' || typeof b === 'object') { raise(TypeError, ERR.comparatorRequired('BST')); } // Default: keys are equal (fallback case) return 0; }; } /** * (Protected) Binary search for floor by key with pruning optimization. * Performs standard BST binary search, choosing left or right subtree based on comparator result. * Finds first node where key <= target. * @remarks Time O(h) where h is tree height. * * @param key - The target key to search for. * @param iterationType - The iteration type (RECURSIVE or ITERATIVE). * @returns The first node with key <= target, or undefined if none exists. */ protected _floorByKey(key: K, iterationType: IterationType): BSTNode | undefined { if (iterationType === 'RECURSIVE') { // Recursive binary search implementation const dfs = (cur: BSTNode | null | undefined): BSTNode | undefined => { if (!this.isRealNode(cur)) return undefined; const cmp = this.comparator(cur.key!, key); if (cmp <= 0) { // Current node satisfies the floor condition (cur.key <= target). // Try to find a larger candidate in the right subtree. const rightResult = dfs(cur.right); return rightResult ?? cur; } else { // Current node is too large, move left to find smaller keys. return dfs(cur.left); } }; return dfs(this.root); } else { // Iterative binary search implementation let current: BSTNode | undefined = this.root; let result: BSTNode | undefined = undefined; while (this.isRealNode(current)) { const cmp = this.comparator(current.key!, key); if (cmp <= 0) { // Current node is a candidate. Save it and try right subtree for a larger key. result = current; current = current.right ?? undefined; } else { // Current node is too large, move left. current = current.left ?? undefined; } } return result; } } /** * (Protected) In-order traversal search for floor by predicate. * Falls back to linear in-order traversal when predicate-based search is required. * Returns the last node that satisfies the predicate function. * @remarks Time Complexity: O(n) since it may visit every node. * Space Complexity: O(h) for recursion, O(h) for iterative stack. * * @param predicate - The predicate function to test nodes. * @param iterationType - The iteration type (RECURSIVE or ITERATIVE). * @returns The last node satisfying predicate (highest key), or undefined if none found. */ protected _floorByPredicate( predicate: NodePredicate>, iterationType: IterationType ): BSTNode | undefined { if (iterationType === 'RECURSIVE') { // Recursive in-order traversal let result: BSTNode | undefined = undefined; const dfs = (cur: BSTNode | null | undefined): void => { if (!this.isRealNode(cur)) return; // In-order: process left subtree first if (this.isRealNode(cur.left)) dfs(cur.left); // Check current node if (predicate(cur)) { result = cur; } // Process right subtree if (this.isRealNode(cur.right)) dfs(cur.right); }; dfs(this.root); return result; } else { // Iterative in-order traversal using explicit stack const stack: (BSTNode | null | undefined)[] = []; let current: BSTNode | null | undefined = this.root; let result: BSTNode | undefined = undefined; while (stack.length > 0 || this.isRealNode(current)) { if (this.isRealNode(current)) { // Go to the leftmost node stack.push(current); current = current.left; } else { // Pop from stack and process const node = stack.pop(); if (!this.isRealNode(node)) break; // Check if current node satisfies predicate if (predicate(node)) { result = node; } // Visit right subtree current = node.right; } } return result; } } /** * (Protected) Binary search for lower by key with pruning optimization. * Performs standard BST binary search, choosing left or right subtree based on comparator result. * Finds first node where key < target. * @remarks Time O(h) where h is tree height. * * @param key - The target key to search for. * @param iterationType - The iteration type (RECURSIVE or ITERATIVE). * @returns The first node with key < target, or undefined if none exists. */ protected _lowerByKey(key: K, iterationType: IterationType): BSTNode | undefined { if (iterationType === 'RECURSIVE') { // Recursive binary search implementation const dfs = (cur: BSTNode | null | undefined): BSTNode | undefined => { if (!this.isRealNode(cur)) return undefined; const cmp = this.comparator(cur.key!, key); if (cmp < 0) { // Current node satisfies the lower condition (cur.key < target). // Try to find a larger candidate in the right subtree. const rightResult = dfs(cur.right); return rightResult ?? cur; } else { // Current node is too large or equal, move left to find smaller keys. return dfs(cur.left); } }; return dfs(this.root); } else { // Iterative binary search implementation let current: BSTNode | undefined = this.root; let result: BSTNode | undefined = undefined; while (this.isRealNode(current)) { const cmp = this.comparator(current.key!, key); if (cmp < 0) { // Current node is a candidate. Save it and try right subtree for a larger key. result = current; current = current.right ?? undefined; } else { // Current node is too large or equal, move left. current = current.left ?? undefined; } } return result; } } /** * (Protected) In-order traversal search for lower by predicate. * Falls back to linear in-order traversal when predicate-based search is required. * Returns the node that satisfies the predicate and appears last in in-order traversal. * @remarks Time Complexity: O(n) since it may visit every node. * Space Complexity: O(h) for recursion, O(h) for iterative stack. * * @param predicate - The predicate function to test nodes. * @param iterationType - The iteration type (RECURSIVE or ITERATIVE). * @returns The last node satisfying predicate (highest key < target), or undefined if none found. */ protected _lowerByPredicate( predicate: NodePredicate>, iterationType: IterationType ): BSTNode | undefined { if (iterationType === 'RECURSIVE') { // Recursive in-order traversal let result: BSTNode | undefined = undefined; const dfs = (cur: BSTNode | null | undefined): void => { if (!this.isRealNode(cur)) return; // In-order: process left subtree first if (this.isRealNode(cur.left)) dfs(cur.left); // Check current node if (predicate(cur)) { result = cur; } // Process right subtree if (this.isRealNode(cur.right)) dfs(cur.right); }; dfs(this.root); return result; } else { // Iterative in-order traversal using explicit stack const stack: (BSTNode | null | undefined)[] = []; let current: BSTNode | null | undefined = this.root; let result: BSTNode | undefined = undefined; while (stack.length > 0 || this.isRealNode(current)) { if (this.isRealNode(current)) { // Go to the leftmost node stack.push(current); current = current.left; } else { // Pop from stack and process const node = stack.pop(); if (!this.isRealNode(node)) break; // Check if current node satisfies predicate if (predicate(node)) { result = node; } // Visit right subtree current = node.right; } } return result; } } /** * (Protected) Core bound search implementation supporting all parameter types. * Unified logic for both lowerBound and upperBound. * Resolves various input types (Key, Node, Entry, Predicate) using parent class utilities. * @param keyNodeEntryOrPredicate - The key, node, entry, or predicate function to search for. * @param isLower - True for lowerBound (>=), false for upperBound (>). * @param iterationType - The iteration type (RECURSIVE or ITERATIVE). * @returns The first matching node, or undefined if no such node exists. */ protected _bound( keyNodeEntryOrPredicate: | K | BSTNode | [K | null | undefined, V | undefined] | null | undefined | NodePredicate>, isLower: boolean, iterationType: IterationType ): BSTNode | undefined { if (keyNodeEntryOrPredicate === null || keyNodeEntryOrPredicate === undefined) { return undefined; } // Check if input is a predicate function first if (this._isPredicate(keyNodeEntryOrPredicate)) { return this._boundByPredicate(keyNodeEntryOrPredicate, iterationType); } // Resolve input to a comparable key let targetKey: K | undefined; if (this.isNode(keyNodeEntryOrPredicate)) { // Input is a BSTNode - extract its key targetKey = keyNodeEntryOrPredicate.key; } else if (this.isEntry(keyNodeEntryOrPredicate)) { // Input is a [key, value] entry - extract the key const key = keyNodeEntryOrPredicate[0]; if (key === null || key === undefined) { return undefined; } targetKey = key; } else { // Input is a raw key targetKey = keyNodeEntryOrPredicate; } // Execute key-based search with binary search optimization if (targetKey !== undefined) { return this._boundByKey(targetKey, isLower, iterationType); } /* istanbul ignore next -- defensive: targetKey is always defined if predicate path was skipped */ return undefined; } /** * (Protected) Binary search for bound by key with pruning optimization. * Performs standard BST binary search, choosing left or right subtree based on comparator result. * For lowerBound: finds first node where key >= target. * For upperBound: finds first node where key > target. * @param key - The target key to search for. * @param isLower - True for lowerBound (>=), false for upperBound (>). * @param iterationType - The iteration type (RECURSIVE or ITERATIVE). * @returns The first node matching the bound condition, or undefined if none exists. */ protected _boundByKey(key: K, isLower: boolean, iterationType: IterationType): BSTNode | undefined { if (iterationType === 'RECURSIVE') { // Recursive binary search implementation const dfs = (cur: BSTNode | null | undefined): BSTNode | undefined => { if (!this.isRealNode(cur)) return undefined; const cmp = this.comparator(cur.key!, key); const condition = isLower ? cmp >= 0 : cmp > 0; if (condition) { // Current node satisfies the bound condition. // Try to find a closer (smaller key) candidate in the left subtree. const leftResult = dfs(cur.left); return leftResult ?? cur; } else { // Current node does not satisfy the condition. // Move right to find larger keys. return dfs(cur.right); } }; return dfs(this.root); } else { // Iterative binary search implementation let current: BSTNode | undefined = this.root; let result: BSTNode | undefined = undefined; while (this.isRealNode(current)) { const cmp = this.comparator(current.key!, key); const condition = isLower ? cmp >= 0 : cmp > 0; if (condition) { // Current node is a candidate. Save it and try left subtree for a closer match. result = current; current = current.left ?? undefined; } else { // Move right to find larger keys. current = current.right ?? undefined; } } return result; } } /** * (Protected) In-order traversal search by predicate. * Falls back to linear in-order traversal when predicate-based search is required. * Returns the first node that satisfies the predicate function. * Note: Predicate-based search cannot leverage BST's binary search optimization. * Time Complexity: O(n) since it may visit every node. * @param predicate - The predicate function to test nodes. * @param iterationType - The iteration type (RECURSIVE or ITERATIVE). * @returns The first node satisfying predicate, or undefined if none found. */ protected _boundByPredicate( predicate: NodePredicate>, iterationType: IterationType ): BSTNode | undefined { if (iterationType === 'RECURSIVE') { // Recursive in-order traversal let result: BSTNode | undefined = undefined; const dfs = (cur: BSTNode | null | undefined): void => { if (result || !this.isRealNode(cur)) return; // In-order: process left subtree first if (this.isRealNode(cur.left)) dfs(cur.left); // Check current node if (!result && predicate(cur)) { result = cur; } // Process right subtree if (!result && this.isRealNode(cur.right)) dfs(cur.right); }; dfs(this.root); return result; } else { // Iterative in-order traversal using explicit stack const stack: (BSTNode | null | undefined)[] = []; let current: BSTNode | null | undefined = this.root; while (stack.length > 0 || this.isRealNode(current)) { if (this.isRealNode(current)) { // Go to the leftmost node stack.push(current); current = current.left; } else { // Pop from stack and process const node = stack.pop(); if (!this.isRealNode(node)) break; // Check if current node satisfies predicate if (predicate(node)) { return node; } // Visit right subtree current = node.right; } } return undefined; } } /** * (Protected) Creates a new, empty instance of the same BST constructor. * @remarks Time O(1) * * @template TK, TV, TR - Generic types for the new instance. * @param [options] - Options for the new BST. * @returns A new, empty BST. */ protected override _createInstance(options?: Partial>): this { const Ctor = this.constructor as unknown as new ( iter?: Iterable | [TK | null | undefined, TV | undefined] | null | undefined | TR>, opts?: BSTOptions ) => BST; return new Ctor([], { ...this._snapshotOptions(), ...(options ?? {}) }) as unknown as this; } /** * (Protected) Creates a new instance of the same BST constructor, potentially with different generic types. * @remarks Time O(N log N) or O(N^2) (from constructor) due to processing the iterable. * * @template TK, TV, TR - Generic types for the new instance. * @param [iter=[]] - An iterable to populate the new BST. * @param [options] - Options for the new BST. * @returns A new BST. */ protected override _createLike( iter: Iterable | [TK | null | undefined, TV | undefined] | null | undefined | TR> = [], options?: Partial> ): BST { const Ctor = this.constructor as unknown as new ( iter?: Iterable | [TK | null | undefined, TV | undefined] | null | undefined | TR>, opts?: BSTOptions ) => BST; return new Ctor(iter, { ...this._snapshotOptions(), ...(options ?? {}) }); } /** * (Protected) Snapshots the current BST's configuration options. * @remarks Time O(1) * * @template TK, TV, TR - Generic types for the options. * @returns The options object. */ protected override _snapshotOptions(): BSTOptions { return { ...super._snapshotOptions(), comparator: this._comparator as unknown as BSTOptions['comparator'], enableOrderStatistic: this._enableOrderStatistic }; } /** * (Protected) Converts a key, node, or entry into a standardized [node, value] tuple. * @remarks Time O(1) * * @param keyNodeOrEntry - The input item. * @param [value] - An optional value (used if input is just a key). * @returns A tuple of [node, value]. */ protected override _keyValueNodeOrEntryToNodeAndValue( keyNodeOrEntry: K | BSTNode | [K | null | undefined, V | undefined] | null | undefined, value?: V ): [OptNode>, V | undefined] { const [node, entryValue] = super._keyValueNodeOrEntryToNodeAndValue(keyNodeOrEntry, value); if (node === null) return [undefined, undefined]; // BST handles null differently (as undefined) return [node, value ?? entryValue]; } /** * (Protected) Sets the root node and clears its parent reference. * @remarks Time O(1) * * @param v - The node to set as root. */ /** * (Protected) Recalculates the subtree count for a single node. * @remarks Time O(1). Only active when enableOrderStatistic is true. */ protected _updateCount(node: BSTNode): void { if (!this._enableOrderStatistic) return; node._count = 1 + (this.isRealNode(node.left) ? node.left._count : 0) + (this.isRealNode(node.right) ? node.right._count : 0); } /** * (Protected) Updates subtree counts from a node up to the root. * @remarks Time O(log n). Only active when enableOrderStatistic is true. */ protected _updateCountAlongPath(node: OptNode>): void { if (!this._enableOrderStatistic) return; let current = node; while (current) { this._updateCount(current); current = current.parent as BSTNode | undefined; } } /** * (Protected) Finds the node at position k in tree order (iterative). * @remarks Time O(log n), Space O(1) */ protected _getByRankIterative(node: OptNode>, k: number): BSTNode | undefined { let current = node; let remaining = k; while (current) { const leftCount = this.isRealNode(current.left) ? current.left._count : 0; if (remaining < leftCount) { current = current.left as BSTNode | undefined; } else if (remaining === leftCount) { return current; } else { remaining = remaining - leftCount - 1; current = current.right as BSTNode | undefined; } } return undefined; } /** * (Protected) Finds the node at position k in tree order (recursive). * @remarks Time O(log n), Space O(log n) call stack */ protected _getByRankRecursive(node: OptNode>, k: number): BSTNode | undefined { if (!node) return undefined; const leftCount = this.isRealNode(node.left) ? node.left._count : 0; if (k < leftCount) return this._getByRankRecursive(node.left as BSTNode | undefined, k); if (k === leftCount) return node; return this._getByRankRecursive(node.right as BSTNode | undefined, k - leftCount - 1); } /** * (Protected) Computes the rank of a key iteratively. * @remarks Time O(log n), Space O(1) */ protected _getRankIterative(node: OptNode>, key: K): number { let rank = 0; let current = node; while (this.isRealNode(current)) { const cmp = this._compare(current.key, key); if (cmp > 0) { // key < current.key, go left current = current.left as BSTNode | undefined; } else if (cmp < 0) { // key > current.key rank += (this.isRealNode(current.left) ? current.left._count : 0) + 1; current = current.right as BSTNode | undefined; } else { // Found rank += this.isRealNode(current.left) ? current.left._count : 0; return rank; } } // Key not found, rank = insertion position return rank; } /** * (Protected) Computes the rank of a key recursively. * @remarks Time O(log n), Space O(log n) call stack */ protected _getRankRecursive(node: OptNode>, key: K): number { if (!node) return 0; const cmp = this._compare(node.key, key); if (cmp > 0) { return this._getRankRecursive(node.left as BSTNode | undefined, key); } else if (cmp < 0) { return (this.isRealNode(node.left) ? node.left._count : 0) + 1 + this._getRankRecursive(node.right as BSTNode | undefined, key); } else { return this.isRealNode(node.left) ? node.left._count : 0; } } /** * (Protected) Finds the in-order successor of a node. * @remarks Time O(log n), Space O(1) */ protected _next(node: BSTNode): BSTNode | undefined { if (this.isRealNode(node.right)) { // Leftmost in right subtree let current = node.right as BSTNode; while (this.isRealNode(current.left)) { current = current.left as BSTNode; } return current; } // Go up until we come from a left child let current: BSTNode | undefined = node; let parent = current.parent as BSTNode | undefined; while (parent && current === parent.right) { current = parent; parent = parent.parent as BSTNode | undefined; } return parent; } protected override _setRoot(v: OptNode>) { if (v) v.parent = undefined; this._root = v; } /** * (Protected) Compares two keys using the tree's comparator and reverse setting. * @remarks Time O(1) Space O(1) * * @param a - The first key. * @param b - The second key. * @returns A number (1, -1, or 0) representing the comparison. */ protected _compare(a: K, b: K) { return this._comparator(a, b); } /** * (Private) Deletes a node by its key. * @remarks Standard BST deletion algorithm. Time O(log N), O(N) worst-case. Space O(1). * * @param key - The key of the node to delete. * @returns True if the node was found and deleted, false otherwise. */ protected _deleteByKey(key: K): boolean { let node = this._root as BSTNode | undefined; // 1. Find the node while (node) { const cmp = this._compare(node.key, key); if (cmp === 0) break; node = cmp > 0 ? (node.left as BSTNode | undefined) : (node.right as BSTNode | undefined); } if (!node) return false; // Not found // Helper to replace node `u` with node `v` const transplant = (u: BSTNode | undefined, v: BSTNode | undefined) => { const p = u?.parent as BSTNode | undefined; if (!p) { this._setRoot(v); } else if (p.left === u) { p.left = v; } else { p.right = v; } if (v) v.parent = p; }; // Helper to find the minimum node in a subtree const minNode = (x: BSTNode | undefined): BSTNode | undefined => { if (!x) return undefined; while (x.left !== undefined && x.left !== null) x = x.left as BSTNode; return x; }; // 2. Perform deletion let countUpdateStart: BSTNode | undefined; if (node.left === undefined) { // Case 1: No left child countUpdateStart = node.parent as BSTNode | undefined; transplant(node, node.right as BSTNode | undefined); } else if (node.right === undefined) { // Case 2: No right child countUpdateStart = node.parent as BSTNode | undefined; transplant(node, node.left as BSTNode | undefined); } else { // Case 3: Two children const succ = minNode(node.right as BSTNode | undefined)!; // Find successor if (succ.parent !== node) { countUpdateStart = succ.parent as BSTNode | undefined; transplant(succ, succ.right as BSTNode | undefined); succ.right = node.right as BSTNode | undefined; if (succ.right) (succ.right as BSTNode).parent = succ; } else { countUpdateStart = succ; } transplant(node, succ); succ.left = node.left as BSTNode | undefined; if (succ.left) (succ.left as BSTNode).parent = succ; } this._updateCountAlongPath(countUpdateStart); this._size = Math.max(0, this._size - 1); return true; } }