[**data-structure-typed**](../README.md)

***

[data-structure-typed](../README.md) / MaxHeap

# Class: MaxHeap\<E, R\>

Defined in: [data-structures/heap/max-heap.ts:73](https://github.com/zrwusa/data-structure-typed/blob/main/src/data-structures/heap/max-heap.ts#L73)

## Examples

```ts
// Find the K largest elements
 const data = [3, 1, 4, 1, 5, 9, 2, 6, 5, 3, 5];
    const heap = new MaxHeap(data);

    // Extract top 3 elements
    const top3 = [];
    for (let i = 0; i < 3; i++) {
      top3.push(heap.poll());
    }
    console.log(top3); // [9, 6, 5];
```

```ts
// Priority-based task processing
 interface Task {
      name: string;
      priority: number;
    }

    const heap = new MaxHeap<Task>([], {
      comparator: (a, b) => b.priority - a.priority
    });

    heap.add({ name: 'Low priority', priority: 1 });
    heap.add({ name: 'Critical fix', priority: 10 });
    heap.add({ name: 'Medium task', priority: 5 });

    // Highest priority first
    console.log(heap.poll()?.name); // 'Critical fix';
    console.log(heap.poll()?.name); // 'Medium task';
    console.log(heap.poll()?.name); // 'Low priority';
```

```ts
// Real-time top score tracking
 const scores = new MaxHeap<number>();

    // Stream of scores coming in
    for (const score of [72, 85, 91, 68, 95, 78, 88]) {
      scores.add(score);
    }

    // Current highest score without removing
    console.log(scores.peek()); // 95;
    console.log(scores.size); // 7;

    // Remove top 2 scores
    console.log(scores.poll()); // 95;
    console.log(scores.poll()); // 91;
    console.log(scores.peek()); // 88;
```

## Extends

- [`Heap`](Heap.md)\<`E`, `R`\>

## Type Parameters

### E

`E` = `any`

### R

`R` = `any`

Max-oriented binary heap.
Notes and typical use-cases are documented in [Heap](Heap.md).

1. Complete Binary Tree: Heaps are typically complete binary trees, meaning every level is fully filled except possibly for the last level, which has nodes as far left as possible.
2. Heap Properties: The value of each parent node is greater than or equal to the value of its children.
3. Root Node Access: In a heap, the largest element (in a max heap) or the smallest element (in a min heap) is always at the root of the tree.
4. Efficient Insertion and Deletion: Due to its structure, a heap allows for insertion and deletion operations in logarithmic time (O(log n)).
5. Managing Dynamic Data Sets: Heaps effectively manage dynamic data sets, especially when frequent access to the largest or smallest elements is required.
6. Non-linear Search: While a heap allows rapid access to its largest or smallest element, it is less efficient for other operations, such as searching for a specific element, as it is not designed for these tasks.
7. Efficient Sorting Algorithms: For example, heap sort. Heap sort uses the properties of a heap to sort elements.
8. Graph Algorithms: Such as Dijkstra's shortest path algorithm and Prim's minimum-spanning tree algorithm, which use heaps to improve performance.

## Constructors

### Constructor

```ts
new MaxHeap<E, R>(elements?, options?): MaxHeap<E, R>;
```

Defined in: [data-structures/heap/max-heap.ts:79](https://github.com/zrwusa/data-structure-typed/blob/main/src/data-structures/heap/max-heap.ts#L79)

Create a max-heap. For objects, supply a custom comparator.

#### Parameters

##### elements?

`Iterable`\<`E`, `any`, `any`\> \| `Iterable`\<`R`, `any`, `any`\>

Optional initial elements.

##### options?

`HeapOptions`\<`E`, `R`\>

Optional configuration.

#### Returns

`MaxHeap`\<`E`, `R`\>

#### Overrides

[`Heap`](Heap.md).[`constructor`](Heap.md#constructor)

## Properties

### comparator

#### Get Signature

```ts
get comparator(): Comparator<E>;
```

Defined in: [data-structures/heap/heap.ts:1314](https://github.com/zrwusa/data-structure-typed/blob/main/src/data-structures/heap/heap.ts#L1314)

Get the comparator used to order elements.

##### Remarks

Time O(1), Space O(1)

##### Returns

`Comparator`\<`E`\>

Comparator function.

#### Inherited from

[`Heap`](Heap.md).[`comparator`](Heap.md#comparator)

***

### elements

#### Get Signature

```ts
get elements(): E[];
```

Defined in: [data-structures/heap/heap.ts:180](https://github.com/zrwusa/data-structure-typed/blob/main/src/data-structures/heap/heap.ts#L180)

Get the backing array of the heap.

##### Remarks

Time O(1), Space O(1)

##### Returns

`E`[]

Internal elements array.

#### Inherited from

[`Heap`](Heap.md).[`elements`](Heap.md#elements)

***

### leaf

#### Get Signature

```ts
get leaf(): E | undefined;
```

Defined in: [data-structures/heap/heap.ts:251](https://github.com/zrwusa/data-structure-typed/blob/main/src/data-structures/heap/heap.ts#L251)

Get the last leaf element.

##### Remarks

Time O(1), Space O(1)

##### Returns

`E` \| `undefined`

Last element or undefined.

#### Inherited from

[`Heap`](Heap.md).[`leaf`](Heap.md#leaf)

***

### size

#### Get Signature

```ts
get size(): number;
```

Defined in: [data-structures/heap/heap.ts:241](https://github.com/zrwusa/data-structure-typed/blob/main/src/data-structures/heap/heap.ts#L241)

Get the number of elements.

##### Remarks

Time O(1), Space O(1)

##### Example

```ts
// Track heap capacity
 const heap = new Heap<number>();
    console.log(heap.size); // 0;
    heap.add(10);
    heap.add(20);
    console.log(heap.size); // 2;
    heap.poll();
    console.log(heap.size); // 1;
```

##### Returns

`number`

Heap size.

 *

#### Inherited from

[`Heap`](Heap.md).[`size`](Heap.md#size)

***

### toElementFn

#### Get Signature

```ts
get toElementFn(): ((rawElement) => E) | undefined;
```

Defined in: [data-structures/base/iterable-element-base.ts:48](https://github.com/zrwusa/data-structure-typed/blob/main/src/data-structures/base/iterable-element-base.ts#L48)

Exposes the current `toElementFn`, if configured.

##### Remarks

Time O(1), Space O(1).

##### Returns

((`rawElement`) => `E`) \| `undefined`

The converter function or `undefined` when not set.

#### Inherited from

[`Heap`](Heap.md).[`toElementFn`](Heap.md#toelementfn)

## Methods

### \[iterator\]()

```ts
iterator: IterableIterator<E>;
```

Defined in: [data-structures/base/iterable-element-base.ts:61](https://github.com/zrwusa/data-structure-typed/blob/main/src/data-structures/base/iterable-element-base.ts#L61)

Returns an iterator over the structure's elements.

#### Parameters

##### args

...`unknown`[]

Optional iterator arguments forwarded to the internal iterator.

#### Returns

`IterableIterator`\<`E`\>

An `IterableIterator<E>` that yields the elements in traversal order.

#### Remarks

Producing the iterator is O(1); consuming the entire iterator is Time O(n) with O(1) extra space.

#### Inherited from

[`Heap`](Heap.md).[`[iterator]`](Heap.md#iterator)

***

### add()

```ts
add(element): boolean;
```

Defined in: [data-structures/heap/heap.ts:352](https://github.com/zrwusa/data-structure-typed/blob/main/src/data-structures/heap/heap.ts#L352)

Insert an element.

#### Parameters

##### element

`E`

Element to insert.

#### Returns

`boolean`

True.

 *

#### Remarks

Time O(log N) amortized, Space O(1)

#### Example

```ts
// basic Heap creation and add operation
 // Create a min heap (default)
    const minHeap = new Heap([5, 3, 7, 1, 9, 2]);

    // Verify size
    console.log(minHeap.size); // 6;

    // Add new element
    minHeap.add(4);
    console.log(minHeap.size); // 7;

    // Min heap property: smallest element at root
    const min = minHeap.peek();
    console.log(min); // 1;
```

#### Inherited from

[`Heap`](Heap.md).[`add`](Heap.md#add)

***

### addMany()

```ts
addMany(elements): boolean[];
```

Defined in: [data-structures/heap/heap.ts:409](https://github.com/zrwusa/data-structure-typed/blob/main/src/data-structures/heap/heap.ts#L409)

Insert many elements from an iterable.

#### Parameters

##### elements

`Iterable`\<`E` \| `R`\>

Iterable of elements or raw values.

#### Returns

`boolean`[]

Array of per-element success flags.

 *

#### Remarks

Time O(N log N), Space O(1)

#### Example

```ts
// Add multiple elements
 const heap = new Heap<number>([], { comparator: (a, b) => a - b });
    heap.addMany([5, 3, 7, 1]);
    console.log(heap.peek()); // 1;
    console.log(heap.size); // 4;
```

#### Inherited from

[`Heap`](Heap.md).[`addMany`](Heap.md#addmany)

***

### clear()

```ts
clear(): void;
```

Defined in: [data-structures/heap/heap.ts:761](https://github.com/zrwusa/data-structure-typed/blob/main/src/data-structures/heap/heap.ts#L761)

Remove all elements.

#### Returns

`void`

void

 *

#### Remarks

Time O(1), Space O(1)

#### Example

```ts
// Remove all elements
 const heap = new Heap<number>([1, 2, 3], { comparator: (a, b) => a - b });
    heap.clear();
    console.log(heap.isEmpty()); // true;
```

#### Inherited from

[`Heap`](Heap.md).[`clear`](Heap.md#clear)

***

### clone()

```ts
clone(): this;
```

Defined in: [data-structures/heap/heap.ts:1136](https://github.com/zrwusa/data-structure-typed/blob/main/src/data-structures/heap/heap.ts#L1136)

Deep clone this heap.

#### Returns

`this`

A new heap with the same elements.

 *

#### Remarks

Time O(N), Space O(N)

#### Example

```ts
// Create independent copy
 const heap = new Heap<number>([3, 1, 4], { comparator: (a, b) => a - b });
    const copy = heap.clone();
    copy.poll();
    console.log(heap.size); // 3;
    console.log(copy.size); // 2;
```

#### Inherited from

[`Heap`](Heap.md).[`clone`](Heap.md#clone)

***

### delete()

```ts
delete(element): boolean;
```

Defined in: [data-structures/heap/heap.ts:868](https://github.com/zrwusa/data-structure-typed/blob/main/src/data-structures/heap/heap.ts#L868)

Delete one occurrence of an element.

#### Parameters

##### element

`E`

Element to delete.

#### Returns

`boolean`

True if an element was removed.

 *

#### Remarks

Time O(N), Space O(1)

#### Example

```ts
// Remove specific element
 const heap = new Heap<number>([3, 1, 4, 1, 5], { comparator: (a, b) => a - b });
    heap.delete(4);
    console.log(heap.toArray().includes(4)); // false;
```

#### Inherited from

[`Heap`](Heap.md).[`delete`](Heap.md#delete)

***

### ~~deleteBy()~~

```ts
deleteBy(predicate): boolean;
```

Defined in: [data-structures/heap/heap.ts:892](https://github.com/zrwusa/data-structure-typed/blob/main/src/data-structures/heap/heap.ts#L892)

#### Parameters

##### predicate

(`element`, `index`, `heap`) => `boolean`

#### Returns

`boolean`

#### Deprecated

Use `deleteWhere` instead. Will be removed in a future major version.

#### Inherited from

[`Heap`](Heap.md).[`deleteBy`](Heap.md#deleteby)

***

### deleteWhere()

```ts
deleteWhere(predicate): boolean;
```

Defined in: [data-structures/heap/heap.ts:902](https://github.com/zrwusa/data-structure-typed/blob/main/src/data-structures/heap/heap.ts#L902)

Delete the first element that matches a predicate.

#### Parameters

##### predicate

(`element`, `index`, `heap`) => `boolean`

Function (element, index, heap) → boolean.

#### Returns

`boolean`

True if an element was removed.

#### Remarks

Time O(N), Space O(1)

#### Inherited from

[`Heap`](Heap.md).[`deleteWhere`](Heap.md#deletewhere)

***

### dfs()

```ts
dfs(order?): E[];
```

Defined in: [data-structures/heap/heap.ts:980](https://github.com/zrwusa/data-structure-typed/blob/main/src/data-structures/heap/heap.ts#L980)

Traverse the binary heap as a complete binary tree and collect elements.

#### Parameters

##### order?

`DFSOrderPattern` = `'PRE'`

Traversal order: 'PRE' | 'IN' | 'POST'.

#### Returns

`E`[]

Array of visited elements.

 *

#### Remarks

Time O(N), Space O(H)

#### Example

```ts
// Depth-first traversal
 const heap = new Heap<number>([3, 1, 2], { comparator: (a, b) => a - b });
    const result = heap.dfs('IN');
    console.log(result.length); // 3;
```

#### Inherited from

[`Heap`](Heap.md).[`dfs`](Heap.md#dfs)

***

### entries()

```ts
entries(): IterableIterator<[number, E]>;
```

Defined in: [data-structures/base/iterable-element-base.ts:208](https://github.com/zrwusa/data-structure-typed/blob/main/src/data-structures/base/iterable-element-base.ts#L208)

Return an iterator of `[index, value]` pairs (Array-compatible).

#### Returns

`IterableIterator`\<\[`number`, `E`\]\>

#### Remarks

Provided for familiarity when migrating from Array. Time O(n), Space O(1) per step.

#### Inherited from

[`Heap`](Heap.md).[`entries`](Heap.md#entries)

***

### every()

```ts
every(predicate, thisArg?): boolean;
```

Defined in: [data-structures/base/iterable-element-base.ts:87](https://github.com/zrwusa/data-structure-typed/blob/main/src/data-structures/base/iterable-element-base.ts#L87)

Tests whether all elements satisfy the predicate.

#### Parameters

##### predicate

`ElementCallback`\<`E`, `R`, `boolean`\>

Function invoked for each element with signature `(value, index, self)`.

##### thisArg?

`unknown`

Optional `this` binding for the predicate.

#### Returns

`boolean`

`true` if every element passes; otherwise `false`.

#### Remarks

Time O(n) in the worst case; may exit early when the first failure is found. Space O(1).

#### Inherited from

[`Heap`](Heap.md).[`every`](Heap.md#every)

***

### filter()

```ts
filter(callback, thisArg?): this;
```

Defined in: [data-structures/heap/heap.ts:1195](https://github.com/zrwusa/data-structure-typed/blob/main/src/data-structures/heap/heap.ts#L1195)

Filter elements into a new heap of the same class.

#### Parameters

##### callback

`ElementCallback`\<`E`, `R`, `boolean`\>

Predicate (element, index, heap) → boolean to keep element.

##### thisArg?

`unknown`

Value for `this` inside the callback.

#### Returns

`this`

A new heap with the kept elements.

 *

#### Remarks

Time O(N log N), Space O(N)

#### Example

```ts
// Filter elements
 const heap = new Heap<number>([1, 2, 3, 4, 5], { comparator: (a, b) => a - b });
    const evens = heap.filter(x => x % 2 === 0);
    console.log(evens.size); // 2;
```

#### Inherited from

[`Heap`](Heap.md).[`filter`](Heap.md#filter)

***

### find()

#### Call Signature

```ts
find<S>(predicate, thisArg?): S | undefined;
```

Defined in: [data-structures/base/iterable-element-base.ts:163](https://github.com/zrwusa/data-structure-typed/blob/main/src/data-structures/base/iterable-element-base.ts#L163)

Finds the first element that satisfies the predicate and returns it.

Finds the first element of type `S` (a subtype of `E`) that satisfies the predicate and returns it.

##### Type Parameters

###### S

`S`

##### Parameters

###### predicate

`ElementCallback`\<`E`, `R`, `S`\>

Type-guard predicate: `(value, index, self) => value is S`.

###### thisArg?

`unknown`

Optional `this` binding for the predicate.

##### Returns

`S` \| `undefined`

The matched element typed as `S`, or `undefined` if not found.

##### Remarks

Time O(n) in the worst case; may exit early on the first match. Space O(1).

##### Inherited from

[`Heap`](Heap.md).[`find`](Heap.md#find)

#### Call Signature

```ts
find(predicate, thisArg?): E | undefined;
```

Defined in: [data-structures/base/iterable-element-base.ts:164](https://github.com/zrwusa/data-structure-typed/blob/main/src/data-structures/base/iterable-element-base.ts#L164)

Finds the first element that satisfies the predicate and returns it.

Finds the first element of type `S` (a subtype of `E`) that satisfies the predicate and returns it.

##### Parameters

###### predicate

`ElementCallback`\<`E`, `R`, `unknown`\>

Type-guard predicate: `(value, index, self) => value is S`.

###### thisArg?

`unknown`

Optional `this` binding for the predicate.

##### Returns

`E` \| `undefined`

The matched element typed as `S`, or `undefined` if not found.

##### Remarks

Time O(n) in the worst case; may exit early on the first match. Space O(1).

##### Inherited from

[`Heap`](Heap.md).[`find`](Heap.md#find)

***

### fix()

```ts
fix(): boolean[];
```

Defined in: [data-structures/heap/heap.ts:1011](https://github.com/zrwusa/data-structure-typed/blob/main/src/data-structures/heap/heap.ts#L1011)

Restore heap order bottom-up (heapify in-place).

#### Returns

`boolean`[]

Array of per-node results from fixing steps.

#### Remarks

Time O(N), Space O(1)

#### Inherited from

[`Heap`](Heap.md).[`fix`](Heap.md#fix)

***

### forEach()

```ts
forEach(callbackfn, thisArg?): void;
```

Defined in: [data-structures/base/iterable-element-base.ts:133](https://github.com/zrwusa/data-structure-typed/blob/main/src/data-structures/base/iterable-element-base.ts#L133)

Invokes a callback for each element in iteration order.

#### Parameters

##### callbackfn

`ElementCallback`\<`E`, `R`, `void`\>

Function invoked per element with signature `(value, index, self)`.

##### thisArg?

`unknown`

Optional `this` binding for the callback.

#### Returns

`void`

`void`.

#### Remarks

Time O(n), Space O(1).

#### Inherited from

[`Heap`](Heap.md).[`forEach`](Heap.md#foreach)

***

### has()

```ts
has(element): boolean;
```

Defined in: [data-structures/heap/heap.ts:812](https://github.com/zrwusa/data-structure-typed/blob/main/src/data-structures/heap/heap.ts#L812)

Check if an equal element exists in the heap.

#### Parameters

##### element

`E`

Element to search for.

#### Returns

`boolean`

True if found.

 *

#### Remarks

Time O(N), Space O(1)

#### Example

```ts
// Check element existence
 const heap = new Heap<number>([3, 1, 2], { comparator: (a, b) => a - b });
    console.log(heap.has(1)); // true;
    console.log(heap.has(99)); // false;
```

#### Inherited from

[`Heap`](Heap.md).[`has`](Heap.md#has)

***

### includes()

```ts
includes(element): boolean;
```

Defined in: [data-structures/base/iterable-element-base.ts:200](https://github.com/zrwusa/data-structure-typed/blob/main/src/data-structures/base/iterable-element-base.ts#L200)

Check whether a value exists (Array-compatible alias for `has`).

#### Parameters

##### element

`E`

Element to search for (uses `===`).

#### Returns

`boolean`

`true` if found.

#### Remarks

Provided for familiarity when migrating from Array. Time O(n), Space O(1).

#### Inherited from

[`Heap`](Heap.md).[`includes`](Heap.md#includes)

***

### isEmpty()

```ts
isEmpty(): boolean;
```

Defined in: [data-structures/heap/heap.ts:706](https://github.com/zrwusa/data-structure-typed/blob/main/src/data-structures/heap/heap.ts#L706)

Check whether the heap is empty.

#### Returns

`boolean`

True if size is 0.

 *

#### Remarks

Time O(1), Space O(1)

#### Example

```ts
// Check if heap is empty
 const heap = new Heap<number>([], { comparator: (a, b) => a - b });
    console.log(heap.isEmpty()); // true;
    heap.add(1);
    console.log(heap.isEmpty()); // false;
```

#### Inherited from

[`Heap`](Heap.md).[`isEmpty`](Heap.md#isempty)

***

### keys()

```ts
keys(): IterableIterator<number>;
```

Defined in: [data-structures/base/iterable-element-base.ts:219](https://github.com/zrwusa/data-structure-typed/blob/main/src/data-structures/base/iterable-element-base.ts#L219)

Return an iterator of numeric indices (Array-compatible).

#### Returns

`IterableIterator`\<`number`\>

#### Remarks

Provided for familiarity when migrating from Array. Time O(n), Space O(1) per step.

#### Inherited from

[`Heap`](Heap.md).[`keys`](Heap.md#keys)

***

### map()

```ts
map<EM, RM>(
   callback, 
   options, 
thisArg?): Heap<EM, RM>;
```

Defined in: [data-structures/heap/heap.ts:1263](https://github.com/zrwusa/data-structure-typed/blob/main/src/data-structures/heap/heap.ts#L1263)

Map elements into a new heap of possibly different element type.

#### Type Parameters

##### EM

`EM`

##### RM

`RM`

#### Parameters

##### callback

`ElementCallback`\<`E`, `R`, `EM`\>

Mapping function (element, index, heap) → newElement.

##### options

`IterableElementBaseOptions`\<`EM`, `RM`\> & `object` & `object`

Options for the output heap, including comparator for EM.

##### thisArg?

`unknown`

Value for `this` inside the callback.

#### Returns

[`Heap`](Heap.md)\<`EM`, `RM`\>

A new heap with mapped elements.

 *

#### Remarks

Time O(N log N), Space O(N)

#### Example

```ts
// Transform elements
 const heap = new Heap<number>([1, 2, 3], { comparator: (a, b) => a - b });
    const doubled = heap.map(x => x * 2, { comparator: (a, b) => a - b });
    console.log(doubled.peek()); // 2;
```

#### Inherited from

[`Heap`](Heap.md).[`map`](Heap.md#map)

***

### mapSame()

```ts
mapSame(callback, thisArg?): this;
```

Defined in: [data-structures/heap/heap.ts:1287](https://github.com/zrwusa/data-structure-typed/blob/main/src/data-structures/heap/heap.ts#L1287)

Map elements into a new heap of the same element type.

#### Parameters

##### callback

`ElementCallback`\<`E`, `R`, `E`\>

Mapping function (element, index, heap) → element.

##### thisArg?

`unknown`

Value for `this` inside the callback.

#### Returns

`this`

A new heap with mapped elements.

#### Remarks

Time O(N log N), Space O(N)

#### Inherited from

[`Heap`](Heap.md).[`mapSame`](Heap.md#mapsame)

***

### peek()

```ts
peek(): E | undefined;
```

Defined in: [data-structures/heap/heap.ts:650](https://github.com/zrwusa/data-structure-typed/blob/main/src/data-structures/heap/heap.ts#L650)

Get the current top element without removing it.

#### Returns

`E` \| `undefined`

Top element or undefined.

 *

#### Remarks

Time O(1), Space O(1)

#### Example

```ts
// Heap for event processing with priority
 interface Event {
      id: number;
      type: 'critical' | 'warning' | 'info';
      timestamp: number;
      message: string;
    }

    // Custom priority: critical > warning > info
    const priorityMap = { critical: 3, warning: 2, info: 1 };

    const eventHeap = new Heap<Event>([], {
      comparator: (a: Event, b: Event) => {
        const priorityA = priorityMap[a.type];
        const priorityB = priorityMap[b.type];
        return priorityB - priorityA; // Higher priority first
      }
    });

    // Add events in random order
    eventHeap.add({ id: 1, type: 'info', timestamp: 100, message: 'User logged in' });
    eventHeap.add({ id: 2, type: 'critical', timestamp: 101, message: 'Server down' });
    eventHeap.add({ id: 3, type: 'warning', timestamp: 102, message: 'High memory' });
    eventHeap.add({ id: 4, type: 'info', timestamp: 103, message: 'Cache cleared' });
    eventHeap.add({ id: 5, type: 'critical', timestamp: 104, message: 'Database error' });

    console.log(eventHeap.size); // 5;

    // Process events by priority (critical first)
    const processedOrder: Event[] = [];
    while (eventHeap.size > 0) {
      const event = eventHeap.poll();
      if (event) {
        processedOrder.push(event);
      }
    }

    // Verify critical events came first
    console.log(processedOrder[0].type); // 'critical';
    console.log(processedOrder[1].type); // 'critical';
    console.log(processedOrder[2].type); // 'warning';
    console.log(processedOrder[3].type); // 'info';
    console.log(processedOrder[4].type); // 'info';

    // Verify O(log n) operations
    const newHeap = new Heap<number>([5, 3, 7, 1]);

    // Add - O(log n)
    newHeap.add(2);
    console.log(newHeap.size); // 5;

    // Poll - O(log n)
    const removed = newHeap.poll();
    console.log(removed); // 1;

    // Peek - O(1)
    const top = newHeap.peek();
    console.log(top); // 2;
```

#### Inherited from

[`Heap`](Heap.md).[`peek`](Heap.md#peek)

***

### ~~poll()~~

```ts
poll(): E | undefined;
```

Defined in: [data-structures/heap/heap.ts:523](https://github.com/zrwusa/data-structure-typed/blob/main/src/data-structures/heap/heap.ts#L523)

#### Returns

`E` \| `undefined`

#### Deprecated

Use `pop` instead. Will be removed in a future major version.

 *

#### Example

```ts
// Heap with custom comparator (MaxHeap behavior)
 interface Task {
      id: number;
      priority: number;
      name: string;
    }

    // Custom comparator for max heap behavior (higher priority first)
    const tasks: Task[] = [
      { id: 1, priority: 5, name: 'Email' },
      { id: 2, priority: 3, name: 'Chat' },
      { id: 3, priority: 8, name: 'Alert' }
    ];

    const maxHeap = new Heap(tasks, {
      comparator: (a: Task, b: Task) => b.priority - a.priority
    });

    console.log(maxHeap.size); // 3;

    // Peek returns highest priority task
    const topTask = maxHeap.peek();
    console.log(topTask?.priority); // 8;
    console.log(topTask?.name); // 'Alert';
```

#### Inherited from

[`Heap`](Heap.md).[`poll`](Heap.md#poll)

***

### pop()

```ts
pop(): E | undefined;
```

Defined in: [data-structures/heap/heap.ts:532](https://github.com/zrwusa/data-structure-typed/blob/main/src/data-structures/heap/heap.ts#L532)

Remove and return the top element (min or max depending on comparator).

#### Returns

`E` \| `undefined`

The removed top element, or undefined if empty.

#### Remarks

Time O(log N) amortized, Space O(1)

#### Inherited from

[`Heap`](Heap.md).[`pop`](Heap.md#pop)

***

### print()

```ts
print(): void;
```

Defined in: [data-structures/base/iterable-element-base.ts:301](https://github.com/zrwusa/data-structure-typed/blob/main/src/data-structures/base/iterable-element-base.ts#L301)

Prints `toVisual()` to the console. Intended for quick debugging.

#### Returns

`void`

`void`.

#### Remarks

Time O(n) due to materialization, Space O(n) for the intermediate representation.

#### Inherited from

[`Heap`](Heap.md).[`print`](Heap.md#print)

***

### reduce()

Reduces all elements to a single accumulated value.

#### Param

Reducer of signature `(acc, value, index, self) => nextAcc`. The first element is used as the initial accumulator.

#### Param

Reducer of signature `(acc, value, index, self) => nextAcc`.

#### Param

The initial accumulator value of type `E`.

#### Template

The accumulator type when it differs from `E`.

#### Param

Reducer of signature `(acc: U, value, index, self) => U`.

#### Param

The initial accumulator value of type `U`.

#### Remarks

Time O(n), Space O(1). Throws if called on an empty structure without `initialValue`.

#### Call Signature

```ts
reduce(callbackfn): E;
```

Defined in: [data-structures/base/iterable-element-base.ts:226](https://github.com/zrwusa/data-structure-typed/blob/main/src/data-structures/base/iterable-element-base.ts#L226)

##### Parameters

###### callbackfn

`ReduceElementCallback`\<`E`, `R`\>

##### Returns

`E`

##### Inherited from

[`Heap`](Heap.md).[`reduce`](Heap.md#reduce)

#### Call Signature

```ts
reduce(callbackfn, initialValue): E;
```

Defined in: [data-structures/base/iterable-element-base.ts:227](https://github.com/zrwusa/data-structure-typed/blob/main/src/data-structures/base/iterable-element-base.ts#L227)

##### Parameters

###### callbackfn

`ReduceElementCallback`\<`E`, `R`\>

###### initialValue

`E`

##### Returns

`E`

##### Inherited from

[`Heap`](Heap.md).[`reduce`](Heap.md#reduce)

#### Call Signature

```ts
reduce<U>(callbackfn, initialValue): U;
```

Defined in: [data-structures/base/iterable-element-base.ts:228](https://github.com/zrwusa/data-structure-typed/blob/main/src/data-structures/base/iterable-element-base.ts#L228)

##### Type Parameters

###### U

`U`

##### Parameters

###### callbackfn

`ReduceElementCallback`\<`E`, `R`, `U`\>

###### initialValue

`U`

##### Returns

`U`

##### Inherited from

[`Heap`](Heap.md).[`reduce`](Heap.md#reduce)

***

### setEquality()

```ts
setEquality(equals): this;
```

Defined in: [data-structures/heap/heap.ts:930](https://github.com/zrwusa/data-structure-typed/blob/main/src/data-structures/heap/heap.ts#L930)

Set the equality comparator used by has/delete operations.

#### Parameters

##### equals

(`a`, `b`) => `boolean`

Equality predicate (a, b) → boolean.

#### Returns

`this`

This heap.

#### Remarks

Time O(1), Space O(1)

#### Inherited from

[`Heap`](Heap.md).[`setEquality`](Heap.md#setequality)

***

### some()

```ts
some(predicate, thisArg?): boolean;
```

Defined in: [data-structures/base/iterable-element-base.ts:110](https://github.com/zrwusa/data-structure-typed/blob/main/src/data-structures/base/iterable-element-base.ts#L110)

Tests whether at least one element satisfies the predicate.

#### Parameters

##### predicate

`ElementCallback`\<`E`, `R`, `boolean`\>

Function invoked for each element with signature `(value, index, self)`.

##### thisArg?

`unknown`

Optional `this` binding for the predicate.

#### Returns

`boolean`

`true` if any element passes; otherwise `false`.

#### Remarks

Time O(n) in the worst case; may exit early on first success. Space O(1).

#### Inherited from

[`Heap`](Heap.md).[`some`](Heap.md#some)

***

### sort()

```ts
sort(): E[];
```

Defined in: [data-structures/heap/heap.ts:1072](https://github.com/zrwusa/data-structure-typed/blob/main/src/data-structures/heap/heap.ts#L1072)

Return all elements in ascending order by repeatedly polling.

#### Returns

`E`[]

Sorted array of elements.

 *

#### Remarks

Time O(N log N), Space O(N)

#### Example

```ts
// Sort elements using heap
 const heap = new Heap<number>([5, 1, 3, 2, 4]);
    const sorted = heap.sort();
    console.log(sorted); // [1, 2, 3, 4, 5];
```

#### Inherited from

[`Heap`](Heap.md).[`sort`](Heap.md#sort)

***

### toArray()

```ts
toArray(): E[];
```

Defined in: [data-structures/base/iterable-element-base.ts:278](https://github.com/zrwusa/data-structure-typed/blob/main/src/data-structures/base/iterable-element-base.ts#L278)

Materializes the elements into a new array.

#### Returns

`E`[]

A shallow array copy of the iteration order.

#### Remarks

Time O(n), Space O(n).

#### Inherited from

[`Heap`](Heap.md).[`toArray`](Heap.md#toarray)

***

### toVisual()

```ts
toVisual(): E[];
```

Defined in: [data-structures/base/iterable-element-base.ts:290](https://github.com/zrwusa/data-structure-typed/blob/main/src/data-structures/base/iterable-element-base.ts#L290)

Returns a representation of the structure suitable for quick visualization.
Defaults to an array of elements; subclasses may override to provide richer visuals.

#### Returns

`E`[]

A visual representation (array by default).

#### Remarks

Time O(n), Space O(n).

#### Inherited from

[`Heap`](Heap.md).[`toVisual`](Heap.md#tovisual)

***

### values()

```ts
values(): IterableIterator<E>;
```

Defined in: [data-structures/base/iterable-element-base.ts:72](https://github.com/zrwusa/data-structure-typed/blob/main/src/data-structures/base/iterable-element-base.ts#L72)

Returns an iterator over the values (alias of the default iterator).

#### Returns

`IterableIterator`\<`E`\>

An `IterableIterator<E>` over all elements.

#### Remarks

Creating the iterator is O(1); full iteration is Time O(n), Space O(1).

#### Inherited from

[`Heap`](Heap.md).[`values`](Heap.md#values)

***

### from()

```ts
static from<T, R, S>(
   this, 
   elements?, 
   options?): S;
```

Defined in: [data-structures/heap/heap.ts:266](https://github.com/zrwusa/data-structure-typed/blob/main/src/data-structures/heap/heap.ts#L266)

Create a heap of the same class from an iterable.

#### Type Parameters

##### T

`T`

##### R

`R` = `any`

##### S

`S` *extends* [`Heap`](Heap.md)\<`T`, `R`\> = [`Heap`](Heap.md)\<`T`, `R`\>

#### Parameters

##### this

`Object`

##### elements?

`Iterable`\<`T` \| `R`, `any`, `any`\>

Iterable of elements or raw records.

##### options?

`HeapOptions`\<`T`, `R`\>

Heap options including comparator.

#### Returns

`S`

A new heap instance of this class.

#### Remarks

Time O(N), Space O(N)

#### Inherited from

[`Heap`](Heap.md).[`from`](Heap.md#from)

***

### heapify()

```ts
static heapify<EE, RR>(elements, options): Heap<EE, RR>;
```

Defined in: [data-structures/heap/heap.ts:284](https://github.com/zrwusa/data-structure-typed/blob/main/src/data-structures/heap/heap.ts#L284)

Build a Heap from an iterable in linear time given a comparator.

#### Type Parameters

##### EE

`EE` = `any`

##### RR

`RR` = `any`

#### Parameters

##### elements

`Iterable`\<`EE`\>

Iterable of elements.

##### options

`HeapOptions`\<`EE`, `RR`\>

Heap options including comparator.

#### Returns

[`Heap`](Heap.md)\<`EE`, `RR`\>

A new Heap built from elements.

#### Remarks

Time O(N), Space O(N)

#### Inherited from

[`Heap`](Heap.md).[`heapify`](Heap.md#heapify)


---

## Protected Members

### \_toElementFn?

```ts
protected optional _toElementFn?: (rawElement) => E;
```

Defined in: [data-structures/base/iterable-element-base.ts:39](https://github.com/zrwusa/data-structure-typed/blob/main/src/data-structures/base/iterable-element-base.ts#L39)

The converter used to transform a raw element (`R`) into a public element (`E`).

#### Parameters

##### rawElement

`R`

#### Returns

`E`

#### Remarks

Time O(1), Space O(1).

#### Inherited from

[`Heap`](Heap.md).[`_toElementFn`](Heap.md#_toelementfn)

## Accessors

### \_createInstance()

```ts
protected _createInstance(options?): this;
```

Defined in: [data-structures/heap/heap.ts:1360](https://github.com/zrwusa/data-structure-typed/blob/main/src/data-structures/heap/heap.ts#L1360)

(Protected) Create an empty instance of the same concrete class.

#### Parameters

##### options?

`HeapOptions`\<`E`, `R`\>

Options to override comparator or toElementFn.

#### Returns

`this`

A like-kind empty heap instance.

#### Remarks

Time O(1), Space O(1)

#### Inherited from

[`Heap`](Heap.md).[`_createInstance`](Heap.md#_createinstance)

***

### \_createLike()

```ts
protected _createLike<EM, RM>(elements?, options?): Heap<EM, RM>;
```

Defined in: [data-structures/heap/heap.ts:1378](https://github.com/zrwusa/data-structure-typed/blob/main/src/data-structures/heap/heap.ts#L1378)

(Protected) Create a like-kind instance seeded by elements.

#### Type Parameters

##### EM

`EM`

##### RM

`RM`

#### Parameters

##### elements?

`Iterable`\<`EM`, `any`, `any`\> \| `Iterable`\<`RM`, `any`, `any`\>

Iterable of elements or raw values to seed.

##### options?

`HeapOptions`\<`EM`, `RM`\>

Options forwarded to the constructor.

#### Returns

[`Heap`](Heap.md)\<`EM`, `RM`\>

A like-kind heap instance.

#### Remarks

Time O(N log N), Space O(N)

#### Inherited from

[`Heap`](Heap.md).[`_createLike`](Heap.md#_createlike)

***

### \_getIterator()

```ts
protected _getIterator(): IterableIterator<E>;
```

Defined in: [data-structures/heap/heap.ts:1318](https://github.com/zrwusa/data-structure-typed/blob/main/src/data-structures/heap/heap.ts#L1318)

Internal iterator factory used by the default iterator.

#### Returns

`IterableIterator`\<`E`\>

An iterator over elements.

#### Remarks

Implementations should yield in O(1) per element with O(1) extra space when possible.

#### Inherited from

[`Heap`](Heap.md).[`_getIterator`](Heap.md#_getiterator)

***

### \_spawnLike()

```ts
protected _spawnLike<EM, RM>(options?): Heap<EM, RM>;
```

Defined in: [data-structures/heap/heap.ts:1398](https://github.com/zrwusa/data-structure-typed/blob/main/src/data-structures/heap/heap.ts#L1398)

(Protected) Spawn an empty like-kind heap instance.

#### Type Parameters

##### EM

`EM`

##### RM

`RM`

#### Parameters

##### options?

`HeapOptions`\<`EM`, `RM`\>

Options forwarded to the constructor.

#### Returns

[`Heap`](Heap.md)\<`EM`, `RM`\>

An empty like-kind heap instance.

#### Remarks

Time O(1), Space O(1)

#### Inherited from

[`Heap`](Heap.md).[`_spawnLike`](Heap.md#_spawnlike)

***
