/** * data-structure-typed * * @author Pablo Zeng * @copyright Copyright (c) 2022 Pablo Zeng * @license MIT License */ import type { BSTNOptKeyOrNode, BSTOptions, BTNRep, Comparator, DFSOrderPattern, EntryCallback, FamilyPosition, IterationType, NodeCallback, NodePredicate, OptNode, RBTNColor } from '../../types'; import { BinaryTree } from './binary-tree'; import { IBinaryTree } from '../../interfaces'; import { Range } from '../../common'; /** * Represents a Node in a Binary Search Tree. * * @template K - The type of the key. * @template V - The type of the value. */ export declare class BSTNode { key: K; value?: V; parent?: BSTNode; /** * Creates an instance of BSTNode. * @remarks Time O(1), Space O(1) * * @param key - The key of the node. * @param [value] - The value associated with the key. */ constructor(key: K, value?: V); _left?: BSTNode | null | undefined; /** * Gets the left child of the node. * @remarks Time O(1), Space O(1) * * @returns The left child. */ get left(): BSTNode | null | undefined; /** * Sets the left child of the node and updates its parent reference. * @remarks Time O(1), Space O(1) * * @param v - The node to set as the left child. */ set left(v: BSTNode | null | undefined); _right?: BSTNode | null | undefined; /** * Gets the right child of the node. * @remarks Time O(1), Space O(1) * * @returns The right child. */ get right(): BSTNode | null | undefined; /** * Sets the right child of the node and updates its parent reference. * @remarks Time O(1), Space O(1) * * @param v - The node to set as the right child. */ set right(v: BSTNode | null | undefined); _height: number; /** * Gets the height of the node (used in self-balancing trees). * @remarks Time O(1), Space O(1) * * @returns The height. */ get height(): number; /** * Sets the height of the node. * @remarks Time O(1), Space O(1) * * @param value - The new height. */ set height(value: number); _color: RBTNColor; /** * Gets the color of the node (used in Red-Black trees). * @remarks Time O(1), Space O(1) * * @returns The node's color. */ get color(): RBTNColor; /** * Sets the color of the node. * @remarks Time O(1), Space O(1) * * @param value - The new color. */ set color(value: RBTNColor); _count: number; /** * Gets the count of nodes in the subtree rooted at this node (used in order-statistic trees). * @remarks Time O(1), Space O(1) * * @returns The subtree node count. */ get count(): number; /** * Sets the count of nodes in the subtree. * @remarks Time O(1), Space O(1) * * @param value - The new count. */ set count(value: number); /** * Gets the position of the node relative to its parent. * @remarks Time O(1), Space O(1) * * @returns The family position (e.g., 'ROOT', 'LEFT', 'RIGHT'). */ get familyPosition(): FamilyPosition; } /** * Represents a Binary Search Tree (BST). * Keys are ordered, allowing for faster search operations compared to a standard Binary Tree. * @template K - The type of the key. * @template V - The type of the value. * @template R - The type of the raw data object (if using `toEntryFn`). * * 1. Node Order: Each node's left child has a lesser value, and the right child has a greater value. * 2. Unique Keys: No duplicate keys in a standard BST. * 3. Efficient Search: Enables quick search, minimum, and maximum operations. * 4. Inorder Traversal: Yields nodes in ascending order. * 5. Logarithmic Operations: Ideal operations like insertion, deletion, and searching are O(log n) time-efficient. * 6. Balance Variability: Can become unbalanced; special types maintain balance. * 7. No Auto-Balancing: Standard BSTs don't automatically balance themselves. * * @example * // BST delete and search after deletion * const bst = new BST([11, 3, 15, 1, 8, 13, 16, 2, 6, 9, 12, 14, 4, 7, 10, 5]); * * // Delete a leaf node * bst.delete(1); * console.log(bst.has(1)); // false; * * // Delete a node with one child * bst.delete(2); * console.log(bst.has(2)); // false; * * // Delete a node with two children * bst.delete(3); * console.log(bst.has(3)); // false; * * // Size decreases with each deletion * console.log(bst.size); // 13; * * // Other nodes remain searchable * console.log(bst.has(11)); // true; * console.log(bst.has(15)); // true; * @example * // Merge 3 sorted datasets * const dataset1 = new BST([ * [1, 'A'], * [7, 'G'] * ]); * const dataset2 = [ * [2, 'B'], * [6, 'F'] * ]; * const dataset3 = new BST([ * [3, 'C'], * [5, 'E'], * [4, 'D'] * ]); * * // Merge datasets into a single BinarySearchTree * const merged = new BST(dataset1); * merged.setMany(dataset2); * merged.merge(dataset3); * * // Verify merged dataset is in sorted order * console.log([...merged.values()]); // ['A', 'B', 'C', 'D', 'E', 'F', 'G']; * @example * // BST with custom objects for expression evaluation * interface Expression { * id: number; * operator: string; * precedence: number; * } * * // BST efficiently stores and retrieves operators by precedence * const operatorTree = new BST( * [ * [1, { id: 1, operator: '+', precedence: 1 }], * [2, { id: 2, operator: '*', precedence: 2 }], * [3, { id: 3, operator: '/', precedence: 2 }], * [4, { id: 4, operator: '-', precedence: 1 }], * [5, { id: 5, operator: '^', precedence: 3 }] * ], * { isMapMode: false } * ); * * console.log(operatorTree.size); // 5; * * // Quick lookup of operators * const mult = operatorTree.get(2); * console.log(mult?.operator); // '*'; * console.log(mult?.precedence); // 2; * * // Check if operator exists * console.log(operatorTree.has(5)); // true; * console.log(operatorTree.has(99)); // false; * * // Retrieve operator by precedence level * const expNode = operatorTree.getNode(3); * console.log(expNode?.key); // 3; * console.log(expNode?.value?.precedence); // 2; * * // Delete operator and verify * operatorTree.delete(1); * console.log(operatorTree.has(1)); // false; * console.log(operatorTree.size); // 4; * * // Get tree height for optimization analysis * const treeHeight = operatorTree.getHeight(); * console.log(treeHeight); // > 0; * * // Remaining operators are still accessible * const remaining = operatorTree.get(2); * console.log(remaining); // defined; * @example * // Find lowest common ancestor * const bst = new BST([20, 10, 30, 5, 15, 25, 35, 3, 7, 12, 18]); * * // LCA helper function * const findLCA = (num1: number, num2: number): number | undefined => { * const path1 = bst.getPathToRoot(num1); * const path2 = bst.getPathToRoot(num2); * // Find the first common ancestor * return findFirstCommon(path1, path2); * }; * * function findFirstCommon(arr1: (number | undefined)[], arr2: (number | undefined)[]): number | undefined { * for (const num of arr1) { * if (arr2.indexOf(num) !== -1) { * return num; * } * } * return undefined; * } * * // Assertions * console.log(findLCA(3, 10)); // 7; * console.log(findLCA(5, 35)); // 15; * console.log(findLCA(20, 30)); // 25; */ export declare class BST extends BinaryTree implements IBinaryTree { /** * Creates an instance of BST. * @remarks Time O(N log N) or O(N^2) depending on `isBalanceAdd` in `addMany` and input order. Space O(N). * * @param [keysNodesEntriesOrRaws=[]] - An iterable of items to set. * @param [options] - Configuration options for the BST, including comparator. */ constructor(keysNodesEntriesOrRaws?: Iterable, options?: BSTOptions); protected _root?: BSTNode; protected _enableOrderStatistic: boolean; /** * Gets the root node of the tree. * @remarks Time O(1) * * @returns The root node. */ get root(): OptNode>; /** * The comparator function used to determine the order of keys in the tree. * @remarks Time O(1) Space O(1) */ protected readonly _comparator: Comparator; /** * Gets the comparator function used by the tree. * @remarks Time O(1) * * @returns The comparator function. */ get comparator(): Comparator; /** * (Protected) Creates a new BST node. * @remarks Time O(1), Space O(1) * * @param key - The key for the new node. * @param [value] - The value for the new node (used if not in Map mode). * @returns The newly created BSTNode. */ createNode(key: K, value?: V): BSTNode; /** * Ensures the input is a node. If it's a key or entry, it searches for the node. * @remarks Time O(log N) (height of the tree), O(N) worst-case. * * @param keyNodeOrEntry - The item to resolve to a node. * @param [iterationType=this.iterationType] - The traversal method to use if searching. * @returns The resolved node, or undefined if not found. */ ensureNode(keyNodeOrEntry: K | BSTNode | [K | null | undefined, V | undefined] | null | undefined, iterationType?: IterationType): OptNode>; /** * Checks if the given item is a `BSTNode` instance. * @remarks Time O(1), Space O(1) * * @param keyNodeOrEntry - The item to check. * @returns True if it's a BSTNode, false otherwise. */ isNode(keyNodeOrEntry: K | BSTNode | [K | null | undefined, V | undefined] | null | undefined): keyNodeOrEntry is BSTNode; /** * Checks if the given key is valid (comparable). * @remarks Time O(1) * * @param key - The key to validate. * @returns True if the key is valid, false otherwise. */ isValidKey(key: unknown): key is K; /** * Depth-first search traversal * @example * // Depth-first traversal * const bst = new BST([5, 3, 7, 1, 4]); * const inOrder = bst.dfs(node => node.key, 'IN'); * console.log(inOrder); // [1, 3, 4, 5, 7]; */ dfs(): (K | undefined)[]; dfs>>(callback: C, pattern?: DFSOrderPattern, onlyOne?: boolean, startNode?: K | BSTNode | [K | null | undefined, V | undefined] | null | undefined, iterationType?: IterationType): ReturnType[]; /** * BinaryTree level-order traversal * @example * // Breadth-first traversal * const bst = new BST([5, 3, 7]); * const result = bst.bfs(node => node.key); * console.log(result.length); // 3; */ bfs(): (K | undefined)[]; bfs>>(callback: C, startNode?: K | BSTNode | [K | null | undefined, V | undefined] | null | undefined, iterationType?: IterationType): ReturnType[]; /** * Level-order grouping * @example * // Level-order grouping * const bst = new BST([5, 3, 7, 1, 4]); * const levels = bst.listLevels(node => node.key); * console.log(levels); // toBeInstanceOf; * console.log(levels[0].length); // 1; // root level has 1 node * const allKeys = levels.flat().sort((a, b) => a - b); * console.log(allKeys); // [1, 3, 4, 5, 7]; */ listLevels(): (K | undefined)[][]; listLevels>>(callback: C, startNode?: K | BSTNode | [K | null | undefined, V | undefined] | null | undefined, iterationType?: IterationType): ReturnType[][]; /** * Gets the first node matching a predicate. * @remarks Time O(log N) if searching by key, O(N) if searching by predicate. Space O(log N) or O(N). * * @param keyNodeEntryOrPredicate - The key, node, entry, or predicate function to search for. * @param [startNode=this._root] - The node to start the search from. * @param [iterationType=this.iterationType] - The traversal method. * @returns The first matching node, or undefined if not found. * @example * // Get node object by key * const bst = new BST([[5, 'root'], [3, 'left'], [7, 'right']]); * const node = bst.getNode(3); * console.log(node?.key); // 3; * console.log(node?.value); // 'left'; */ getNode(keyNodeEntryOrPredicate: K | BSTNode | [K | null | undefined, V | undefined] | null | undefined | NodePredicate>, startNode?: BSTNOptKeyOrNode>, iterationType?: IterationType): OptNode>; /** * Search nodes by predicate * @example * // Search nodes by predicate * const bst = new BST([[1, 'a'], [2, 'b'], [3, 'c'], [4, 'd']]); * const found = bst.search(node => node.key > 2, true); * console.log(found.length); // >= 1; */ search(keyNodeEntryOrPredicate: K | BSTNode | [K | null | undefined, V | undefined] | null | undefined | NodePredicate> | Range, onlyOne?: boolean): (K | undefined)[]; search>>(keyNodeEntryOrPredicate: K | BSTNode | [K | null | undefined, V | undefined] | null | undefined | NodePredicate> | Range, onlyOne: boolean, callback: C, startNode?: K | BSTNode | [K | null | undefined, V | undefined] | null | undefined, iterationType?: IterationType): ReturnType[]; /** * Find all keys in a range * @example * // Find all keys in a range * const bst = new BST([10, 20, 30, 40, 50]); * console.log(bst.rangeSearch([15, 35])); // [20, 30]; */ rangeSearch(range: Range | [K, K]): (K | undefined)[]; rangeSearch>>(range: Range | [K, K], callback: C, startNode?: K | BSTNode | [K | null | undefined, V | undefined] | null | undefined, iterationType?: IterationType): ReturnType[]; /** * Returns the element at the k-th position in tree order (0-indexed). * @remarks Time O(log n), Space O(1) iterative / O(log n) recursive. Requires `enableOrderStatistic: true`. * Tree order is defined by the comparator — ascending by default, but respects custom comparators (e.g. descending). * * @param k - The 0-based position in tree order (0 = first element). * @returns The key at position k, or `undefined` if out of bounds. * @example * // Order-statistic on BST * const tree = new BST([30, 10, 50, 20, 40], { enableOrderStatistic: true }); * console.log(tree.getByRank(0)); // 10; * console.log(tree.getByRank(4)); // 50; * console.log(tree.getRank(30)); // 2; */ getByRank(k: number): K | undefined; /** * Returns the element at the k-th position in tree order and applies a callback. * @remarks Time O(log n), Space O(1) iterative / O(log n) recursive. Requires `enableOrderStatistic: true`. * * @param k - The 0-based position in tree order (0 = first element). * @param callback - Callback to apply to the found node. * @param iterationType - Iteration strategy ('ITERATIVE' or 'RECURSIVE'). * @returns The callback result, or `undefined` if out of bounds. */ getByRank>>(k: number, callback: C, iterationType?: IterationType): ReturnType | undefined; /** * Returns the 0-based rank of a key (number of elements that precede it in tree order). * @remarks Time O(log n), Space O(1) iterative / O(log n) recursive. Requires `enableOrderStatistic: true`. * Tree order is defined by the comparator. When the key is not found, returns the insertion position. * * @param keyNodeEntryOrPredicate - The key, node, entry `[K, V]`, or predicate to find. * @returns The rank (0-indexed), or -1 if the tree is empty or input is invalid. */ getRank(keyNodeEntryOrPredicate: K | BSTNode | [K | null | undefined, V | undefined] | null | undefined | NodePredicate>): number; /** * Returns the 0-based rank (number of preceding elements in tree order) with explicit iteration type. * @remarks Time O(log n), Space O(1) iterative / O(log n) recursive. Requires `enableOrderStatistic: true`. * * @param keyNodeEntryOrPredicate - The key, node, entry, or predicate to find. * @param iterationType - Iteration strategy ('ITERATIVE' or 'RECURSIVE'). * @returns The rank (0-indexed), or -1 if the tree is empty or input is invalid. */ getRank(keyNodeEntryOrPredicate: K | BSTNode | [K | null | undefined, V | undefined] | null | undefined | NodePredicate>, iterationType: IterationType): number; /** * Returns elements by position range in tree order (0-indexed, inclusive on both ends). * @remarks Time O(log n + k), Space O(k), where k = end - start + 1. Requires `enableOrderStatistic: true`. * * @param start - Start position (inclusive, 0-indexed). Clamped to 0 if negative. * @param end - End position (inclusive, 0-indexed). Clamped to size-1 if too large. * @returns Array of keys in tree order within the specified range. */ rangeByRank(start: number, end: number): (K | undefined)[]; /** * Returns elements by position range in tree order with callback and optional iteration type. * @remarks Time O(log n + k), Space O(k), where k = end - start + 1. Requires `enableOrderStatistic: true`. * * @param start - Start rank (inclusive, 0-indexed). * @param end - End rank (inclusive, 0-indexed). * @param callback - Callback to apply to each node in the range. * @param iterationType - Iteration strategy ('ITERATIVE' or 'RECURSIVE'). * @returns Array of callback results for nodes in the rank range. */ rangeByRank>>(start: number, end: number, callback: C, iterationType?: IterationType): ReturnType[]; /** * Adds a new node to the BST based on key comparison. * @remarks Time O(log N), where H is tree height. O(N) worst-case (unbalanced tree), O(log N) average. Space O(1). * * @param keyNodeOrEntry - The key, node, or entry to set. * @param [value] - The value, if providing just a key. * @returns True if the addition was successful, false otherwise. * @example * // Set a key-value pair * const bst = new BST(); * bst.set(1, 'one'); * bst.set(2, 'two'); * console.log(bst.get(1)); // 'one'; */ set(keyNodeOrEntry: K | BSTNode | [K | null | undefined, V | undefined] | null | undefined, value?: V): boolean; /** * Adds multiple items to the tree. * @remarks If `isBalanceAdd` is true, sorts the input and builds a balanced tree. Time O(N log N) (due to sort and balanced set). * If false, adds items one by one. Time O(N * H), which is O(N^2) worst-case. * Space O(N) for sorting and recursion/iteration stack. * * @param keysNodesEntriesOrRaws - An iterable of items to set. * @param [values] - An optional parallel iterable of values. * @param [isBalanceAdd=true] - If true, builds a balanced tree from the items. * @param [iterationType=this.iterationType] - The traversal method for balanced set (recursive or iterative). * @returns An array of booleans indicating the success of each individual `set` operation. * @example * // Set multiple key-value pairs * const bst = new BST(); * bst.setMany([[1, 'a'], [2, 'b'], [3, 'c']]); * console.log(bst.size); // 3; * console.log(bst.get(2)); // 'b'; */ setMany(keysNodesEntriesOrRaws: Iterable>>, values?: Iterable, isBalanceAdd?: boolean, iterationType?: IterationType): boolean[]; /** * Returns the first key with a value >= target. * Equivalent to Java TreeMap.ceiling. * Time Complexity: O(log n) average, O(h) worst case. * Space Complexity: O(h) for recursion, O(1) for iteration. * @example * // Find the least key ≥ target * const bst = new BST([10, 20, 30, 40, 50]); * console.log(bst.ceiling(25)); // 30; * console.log(bst.ceiling(30)); // 30; * console.log(bst.ceiling(55)); // undefined; */ ceiling(keyNodeEntryOrPredicate: K | BSTNode | [K | null | undefined, V | undefined] | null | undefined | NodePredicate>): K | undefined; /** * Returns the first node with a key >= target and applies callback. * Time Complexity: O(log n) average, O(h) worst case. * Space Complexity: O(h) for recursion, O(1) for iteration. */ ceiling>>(keyNodeEntryOrPredicate: K | BSTNode | [K | null | undefined, V | undefined] | null | undefined | NodePredicate>, callback: C, iterationType?: IterationType): ReturnType; /** * Returns the first key with a value > target. * Equivalent to Java TreeMap.higher. * Time Complexity: O(log n) average, O(h) worst case. * Space Complexity: O(h) for recursion, O(1) for iteration. * @example * // Find the least key strictly > target * const bst = new BST([10, 20, 30, 40]); * console.log(bst.higher(20)); // 30; * console.log(bst.higher(40)); // undefined; */ higher(keyNodeEntryOrPredicate: K | BSTNode | [K | null | undefined, V | undefined] | null | undefined | NodePredicate>): K | undefined; /** * Returns the first node with a key > target and applies callback. * Time Complexity: O(log n) average, O(h) worst case. * Space Complexity: O(h) for recursion, O(1) for iteration. */ higher>>(keyNodeEntryOrPredicate: K | BSTNode | [K | null | undefined, V | undefined] | null | undefined | NodePredicate>, callback: C, iterationType?: IterationType): ReturnType; /** * Returns the first key with a value <= target. * Equivalent to Java TreeMap.floor. * Time Complexity: O(log n) average, O(h) worst case. * Space Complexity: O(h) for recursion, O(1) for iteration. * @example * // Find the greatest key ≤ target * const bst = new BST([10, 20, 30, 40, 50]); * console.log(bst.floor(25)); // 20; * console.log(bst.floor(10)); // 10; * console.log(bst.floor(5)); // undefined; */ floor(keyNodeEntryOrPredicate: K | BSTNode | [K | null | undefined, V | undefined] | null | undefined | NodePredicate>): K | undefined; /** * Returns the first node with a key <= target and applies callback. * Time Complexity: O(log n) average, O(h) worst case. * Space Complexity: O(h) for recursion, O(1) for iteration. */ floor>>(keyNodeEntryOrPredicate: K | BSTNode | [K | null | undefined, V | undefined] | null | undefined | NodePredicate>, callback: C, iterationType?: IterationType): ReturnType; /** * Returns the first key with a value < target. * Equivalent to Java TreeMap.lower. * Time Complexity: O(log n) average, O(h) worst case. * Space Complexity: O(h) for recursion, O(1) for iteration. * @example * // Find the greatest key strictly < target * const bst = new BST([10, 20, 30, 40]); * console.log(bst.lower(30)); // 20; * console.log(bst.lower(10)); // undefined; */ lower(keyNodeEntryOrPredicate: K | BSTNode | [K | null | undefined, V | undefined] | null | undefined | NodePredicate>): K | undefined; /** * Returns the first node with a key < target and applies callback. * Time Complexity: O(log n) average, O(h) worst case. * Space Complexity: O(h) for recursion, O(1) for iteration. */ lower>>(keyNodeEntryOrPredicate: K | BSTNode | [K | null | undefined, V | undefined] | null | undefined | NodePredicate>, callback: C, iterationType?: IterationType): ReturnType; lesserOrGreaterTraverse(): (K | undefined)[]; lesserOrGreaterTraverse>>(callback: C, lesserOrGreater?: number, targetNode?: K | BSTNode | [K | null | undefined, V | undefined] | null | undefined, iterationType?: IterationType): ReturnType[]; /** * Rebuilds the tree to be perfectly balanced. * @remarks Time O(N) (O(N) for DFS, O(N) for sorted build). Space O(N) for node array and recursion stack. * * @param [iterationType=this.iterationType] - The traversal method for the initial node export. * @returns True if successful, false if the tree was empty. * @example * // Rebalance the tree * const bst = new BST(); * // Insert in sorted order (worst case for BST) * for (let i = 1; i <= 7; i++) bst.add(i); * console.log(bst.isAVLBalanced()); // false; * bst.perfectlyBalance(); * console.log(bst.isAVLBalanced()); // true; */ perfectlyBalance(iterationType?: IterationType): boolean; /** * Checks if the tree meets the AVL balance condition (height difference <= 1). * @remarks Time O(N), as it must visit every node to compute height. Space O(log N) for recursion or O(N) for iterative map. * * @param [iterationType=this.iterationType] - The traversal method. * @returns True if the tree is AVL balanced, false otherwise. * @example * // Check if tree is height-balanced * const bst = new BST([3, 1, 5, 2, 4]); * console.log(bst.isAVLBalanced()); // true; */ isAVLBalanced(iterationType?: IterationType): boolean; /** * Creates a new BST by mapping each [key, value] pair to a new entry. * @remarks Time O(N * H), where N is nodes in this tree, and H is height of the new tree during insertion. * Space O(N) for the new tree. * * @template MK - New key type. * @template MV - New value type. * @template MR - New raw type. * @param callback - A function to map each [key, value] pair. * @param [options] - Options for the new BST. * @param [thisArg] - `this` context for the callback. * @returns A new, mapped BST. * @example * // Transform to new tree * const bst = new BST([[1, 10], [2, 20], [3, 30]]); * const doubled = bst.map((value, key) => [key, (value ?? 0) * 2] as [number, number]); * console.log([...doubled.values()]); // [20, 40, 60]; */ map(callback: EntryCallback, options?: Partial>, thisArg?: unknown): BST; /** * Deletes nodes that match a key, node, entry, predicate, or range. * * @remarks * Time Complexity: O(N) for search + O(M log N) for M deletions, where N is tree size. * Space Complexity: O(M) for storing matched nodes and result map. * * @template K - The key type. * @template V - The value type. * * @param keyNodeEntryOrPredicate - The search criteria. Can be one of: * - A key (type K): searches for exact key match using the comparator. * - A BSTNode: searches for the matching node in the tree. * - An entry tuple: searches for the key-value pair. * - A NodePredicate function: tests each node and returns true for matches. * - A Range object: searches for nodes whose keys fall within the specified range (inclusive/exclusive based on range settings). * - null or undefined: treated as no match, returns empty results. * * @param onlyOne - If true, stops the search after finding the first match and only deletes that one node. * If false (default), searches for and deletes all matching nodes. * * @param startNode - The node to start the search from. Can be: * - A key, node, or entry: the method resolves it to a node and searches from that subtree. * - null or undefined: defaults to the root, searching the entire tree. * - Default value: this._root (the tree's root). * * @param iterationType - Controls the internal traversal implementation: * - 'RECURSIVE': uses recursive function calls for traversal. * - 'ITERATIVE': uses explicit stack-based iteration. * - Default: this.iterationType (the tree's default iteration mode). * * @returns A Map containing the deletion results: * - Key: the matched node's key. * - Value: true if the deletion succeeded, false if it failed (e.g., key not found during deletion phase). * - If no nodes match the search criteria, the returned map is empty. */ deleteWhere(keyNodeEntryOrPredicate: K | BSTNode | [K | null | undefined, V | undefined] | null | undefined | NodePredicate> | Range, onlyOne?: boolean, startNode?: K | BSTNode | [K | null | undefined, V | undefined] | null | undefined, iterationType?: IterationType): boolean; /** * (Protected) Creates the default comparator function for keys that don't have a custom comparator. * @remarks Time O(1) Space O(1) * @returns The default comparator function. */ protected _createDefaultComparator(): Comparator; /** * (Protected) Binary search for floor by key with pruning optimization. * Performs standard BST binary search, choosing left or right subtree based on comparator result. * Finds first node where key <= target. * @remarks Time O(h) where h is tree height. * * @param key - The target key to search for. * @param iterationType - The iteration type (RECURSIVE or ITERATIVE). * @returns The first node with key <= target, or undefined if none exists. */ protected _floorByKey(key: K, iterationType: IterationType): BSTNode | undefined; /** * (Protected) In-order traversal search for floor by predicate. * Falls back to linear in-order traversal when predicate-based search is required. * Returns the last node that satisfies the predicate function. * @remarks Time Complexity: O(n) since it may visit every node. * Space Complexity: O(h) for recursion, O(h) for iterative stack. * * @param predicate - The predicate function to test nodes. * @param iterationType - The iteration type (RECURSIVE or ITERATIVE). * @returns The last node satisfying predicate (highest key), or undefined if none found. */ protected _floorByPredicate(predicate: NodePredicate>, iterationType: IterationType): BSTNode | undefined; /** * (Protected) Binary search for lower by key with pruning optimization. * Performs standard BST binary search, choosing left or right subtree based on comparator result. * Finds first node where key < target. * @remarks Time O(h) where h is tree height. * * @param key - The target key to search for. * @param iterationType - The iteration type (RECURSIVE or ITERATIVE). * @returns The first node with key < target, or undefined if none exists. */ protected _lowerByKey(key: K, iterationType: IterationType): BSTNode | undefined; /** * (Protected) In-order traversal search for lower by predicate. * Falls back to linear in-order traversal when predicate-based search is required. * Returns the node that satisfies the predicate and appears last in in-order traversal. * @remarks Time Complexity: O(n) since it may visit every node. * Space Complexity: O(h) for recursion, O(h) for iterative stack. * * @param predicate - The predicate function to test nodes. * @param iterationType - The iteration type (RECURSIVE or ITERATIVE). * @returns The last node satisfying predicate (highest key < target), or undefined if none found. */ protected _lowerByPredicate(predicate: NodePredicate>, iterationType: IterationType): BSTNode | undefined; /** * (Protected) Core bound search implementation supporting all parameter types. * Unified logic for both lowerBound and upperBound. * Resolves various input types (Key, Node, Entry, Predicate) using parent class utilities. * @param keyNodeEntryOrPredicate - The key, node, entry, or predicate function to search for. * @param isLower - True for lowerBound (>=), false for upperBound (>). * @param iterationType - The iteration type (RECURSIVE or ITERATIVE). * @returns The first matching node, or undefined if no such node exists. */ protected _bound(keyNodeEntryOrPredicate: K | BSTNode | [K | null | undefined, V | undefined] | null | undefined | NodePredicate>, isLower: boolean, iterationType: IterationType): BSTNode | undefined; /** * (Protected) Binary search for bound by key with pruning optimization. * Performs standard BST binary search, choosing left or right subtree based on comparator result. * For lowerBound: finds first node where key >= target. * For upperBound: finds first node where key > target. * @param key - The target key to search for. * @param isLower - True for lowerBound (>=), false for upperBound (>). * @param iterationType - The iteration type (RECURSIVE or ITERATIVE). * @returns The first node matching the bound condition, or undefined if none exists. */ protected _boundByKey(key: K, isLower: boolean, iterationType: IterationType): BSTNode | undefined; /** * (Protected) In-order traversal search by predicate. * Falls back to linear in-order traversal when predicate-based search is required. * Returns the first node that satisfies the predicate function. * Note: Predicate-based search cannot leverage BST's binary search optimization. * Time Complexity: O(n) since it may visit every node. * @param predicate - The predicate function to test nodes. * @param iterationType - The iteration type (RECURSIVE or ITERATIVE). * @returns The first node satisfying predicate, or undefined if none found. */ protected _boundByPredicate(predicate: NodePredicate>, iterationType: IterationType): BSTNode | undefined; /** * (Protected) Creates a new, empty instance of the same BST constructor. * @remarks Time O(1) * * @template TK, TV, TR - Generic types for the new instance. * @param [options] - Options for the new BST. * @returns A new, empty BST. */ protected _createInstance(options?: Partial>): this; /** * (Protected) Creates a new instance of the same BST constructor, potentially with different generic types. * @remarks Time O(N log N) or O(N^2) (from constructor) due to processing the iterable. * * @template TK, TV, TR - Generic types for the new instance. * @param [iter=[]] - An iterable to populate the new BST. * @param [options] - Options for the new BST. * @returns A new BST. */ protected _createLike(iter?: Iterable | [TK | null | undefined, TV | undefined] | null | undefined | TR>, options?: Partial>): BST; /** * (Protected) Snapshots the current BST's configuration options. * @remarks Time O(1) * * @template TK, TV, TR - Generic types for the options. * @returns The options object. */ protected _snapshotOptions(): BSTOptions; /** * (Protected) Converts a key, node, or entry into a standardized [node, value] tuple. * @remarks Time O(1) * * @param keyNodeOrEntry - The input item. * @param [value] - An optional value (used if input is just a key). * @returns A tuple of [node, value]. */ protected _keyValueNodeOrEntryToNodeAndValue(keyNodeOrEntry: K | BSTNode | [K | null | undefined, V | undefined] | null | undefined, value?: V): [OptNode>, V | undefined]; /** * (Protected) Sets the root node and clears its parent reference. * @remarks Time O(1) * * @param v - The node to set as root. */ /** * (Protected) Recalculates the subtree count for a single node. * @remarks Time O(1). Only active when enableOrderStatistic is true. */ protected _updateCount(node: BSTNode): void; /** * (Protected) Updates subtree counts from a node up to the root. * @remarks Time O(log n). Only active when enableOrderStatistic is true. */ protected _updateCountAlongPath(node: OptNode>): void; /** * (Protected) Finds the node at position k in tree order (iterative). * @remarks Time O(log n), Space O(1) */ protected _getByRankIterative(node: OptNode>, k: number): BSTNode | undefined; /** * (Protected) Finds the node at position k in tree order (recursive). * @remarks Time O(log n), Space O(log n) call stack */ protected _getByRankRecursive(node: OptNode>, k: number): BSTNode | undefined; /** * (Protected) Computes the rank of a key iteratively. * @remarks Time O(log n), Space O(1) */ protected _getRankIterative(node: OptNode>, key: K): number; /** * (Protected) Computes the rank of a key recursively. * @remarks Time O(log n), Space O(log n) call stack */ protected _getRankRecursive(node: OptNode>, key: K): number; /** * (Protected) Finds the in-order successor of a node. * @remarks Time O(log n), Space O(1) */ protected _next(node: BSTNode): BSTNode | undefined; protected _setRoot(v: OptNode>): void; /** * (Protected) Compares two keys using the tree's comparator and reverse setting. * @remarks Time O(1) Space O(1) * * @param a - The first key. * @param b - The second key. * @returns A number (1, -1, or 0) representing the comparison. */ protected _compare(a: K, b: K): number; /** * (Private) Deletes a node by its key. * @remarks Standard BST deletion algorithm. Time O(log N), O(N) worst-case. Space O(1). * * @param key - The key of the node to delete. * @returns True if the node was found and deleted, false otherwise. */ protected _deleteByKey(key: K): boolean; }